Source code

Revision control

Copy as Markdown

Other Tools

/* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
"use strict";
const {
EXPAND_TAB,
TAB_SIZE,
DETECT_INDENT,
getIndentationFromIteration,
} = require("resource://devtools/shared/indentation.js");
const { debounce } = require("resource://devtools/shared/debounce.js");
const nodeConstants = require("resource://devtools/shared/dom-node-constants.js");
const ENABLE_CODE_FOLDING = "devtools.editor.enableCodeFolding";
const KEYMAP_PREF = "devtools.editor.keymap";
const AUTO_CLOSE = "devtools.editor.autoclosebrackets";
const AUTOCOMPLETE = "devtools.editor.autocomplete";
const CARET_BLINK_TIME = "ui.caretBlinkTime";
const XHTML_NS = "http://www.w3.org/1999/xhtml";
const VALID_KEYMAPS = new Map([
[
"emacs",
"chrome://devtools/content/shared/sourceeditor/codemirror/keymap/emacs.js",
],
[
"vim",
"chrome://devtools/content/shared/sourceeditor/codemirror/keymap/vim.js",
],
[
"sublime",
"chrome://devtools/content/shared/sourceeditor/codemirror/keymap/sublime.js",
],
]);
// Maximum allowed margin (in number of lines) from top or bottom of the editor
// while shifting to a line which was initially out of view.
const MAX_VERTICAL_OFFSET = 3;
const RE_JUMP_TO_LINE = /^(\d+):?(\d+)?/;
const AUTOCOMPLETE_MARK_CLASSNAME = "cm-auto-complete-shadow-text";
const EventEmitter = require("resource://devtools/shared/event-emitter.js");
const { PrefObserver } = require("resource://devtools/client/shared/prefs.js");
const KeyShortcuts = require("resource://devtools/client/shared/key-shortcuts.js");
const { LocalizationHelper } = require("resource://devtools/shared/l10n.js");
const L10N = new LocalizationHelper(
"devtools/client/locales/sourceeditor.properties"
);
loader.lazyRequireGetter(
this,
"wasm",
"resource://devtools/client/shared/sourceeditor/wasm.js"
);
loader.lazyRequireGetter(
this,
"scopeUtils",
"resource://devtools/client/shared/sourceeditor/scope-utils.js"
);
loader.lazyRequireGetter(
this,
"lezerUtils",
"resource://devtools/client/shared/sourceeditor/lezer-utils.js"
);
const { OS } = Services.appinfo;
// CM_BUNDLE and CM_IFRAME represent the HTML and JavaScript that is
// injected into an iframe in order to initialize a CodeMirror instance.
const CM_BUNDLE =
"chrome://devtools/content/shared/sourceeditor/codemirror/codemirror.bundle.js";
const CM_IFRAME =
"chrome://devtools/content/shared/sourceeditor/codemirror/cmiframe.html";
const CM_MAPPING = [
"clearHistory",
"defaultCharWidth",
"extendSelection",
"focus",
"getCursor",
"getLine",
"getScrollInfo",
"getSelection",
"getViewport",
"hasFocus",
"lineCount",
"openDialog",
"redo",
"refresh",
"replaceSelection",
"setSelection",
"somethingSelected",
"undo",
];
const ONLY_SPACES_REGEXP = /^\s*$/;
const editors = new WeakMap();
/**
* A very thin wrapper around CodeMirror. Provides a number
* of helper methods to make our use of CodeMirror easier and
* another method, appendTo, to actually create and append
* the CodeMirror instance.
*
* Note that Editor doesn't expose CodeMirror instance to the
* outside world.
*
* Constructor accepts one argument, config. It is very
* similar to the CodeMirror configuration object so for most
* properties go to CodeMirror's documentation (see below).
*
* Other than that, it accepts one additional and optional
* property contextMenu. This property should be an element, or
* an ID of an element that we can use as a context menu.
*
* This object is also an event emitter.
*
*/
class Editor extends EventEmitter {
// Static methods on the Editor object itself.
/**
* Returns a string representation of a shortcut 'key' with
* a OS specific modifier. Cmd- for Macs, Ctrl- for other
* platforms. Useful with extraKeys configuration option.
*
* CodeMirror defines all keys with modifiers in the following
* order: Shift - Ctrl/Cmd - Alt - Key
*/
static accel(key, modifiers = {}) {
return (
(modifiers.shift ? "Shift-" : "") +
(Services.appinfo.OS == "Darwin" ? "Cmd-" : "Ctrl-") +
(modifiers.alt ? "Alt-" : "") +
key
);
}
/**
* Returns a string representation of a shortcut for a
* specified command 'cmd'. Append Cmd- for macs, Ctrl- for other
* platforms unless noaccel is specified in the options. Useful when overwriting
* or disabling default shortcuts.
*/
static keyFor(cmd, opts = { noaccel: false }) {
const key = L10N.getStr(cmd + ".commandkey");
return opts.noaccel ? key : Editor.accel(key);
}
static modes = {
cljs: { name: "text/x-clojure" },
css: { name: "css" },
fs: { name: "x-shader/x-fragment" },
haxe: { name: "haxe" },
http: { name: "http" },
html: { name: "htmlmixed" },
js: { name: "javascript" },
text: { name: "text" },
vs: { name: "x-shader/x-vertex" },
wasm: { name: "wasm" },
};
container = null;
version = null;
config = null;
Doc = null;
searchState = {
cursors: [],
currentCursorIndex: -1,
query: "",
};
#abortController;
// The id for the current source in the editor (selected source). This is used to:
// * cache the scroll snapshot for tracking scroll positions and the symbols,
// * know when an actual source is displayed (and not only a loading/error message)
#currentDocumentId = null;
#currentDocument = null;
#CodeMirror6;
#compartments;
#effects;
#lastDirty;
#loadedKeyMaps;
#ownerDoc;
#prefObserver;
#win;
#lineGutterMarkers = new Map();
#lineContentMarkers = new Map();
#posContentMarkers = new Map();
#editorDOMEventHandlers = {};
#gutterDOMEventHandlers = {};
// A cache of all the scroll snapshots for the all the sources that
// are currently open in the editor. The keys for the Map are the id's
// for the source and the values are the scroll snapshots for the sources.
#scrollSnapshots = new Map();
#updateListener = null;
// This stores the language support objects used to syntax highlight code,
// These are keyed of the modes.
#languageModes = new Map();
#sources = new Map();
constructor(config) {
super();
const tabSize = Services.prefs.getIntPref(TAB_SIZE);
const useTabs = !Services.prefs.getBoolPref(EXPAND_TAB);
const useAutoClose = Services.prefs.getBoolPref(AUTO_CLOSE);
this.version = null;
this.config = {
cm6: false,
value: "",
mode: Editor.modes.text,
indentUnit: tabSize,
tabSize,
contextMenu: null,
matchBrackets: true,
highlightSelectionMatches: {
wordsOnly: true,
},
extraKeys: {},
indentWithTabs: useTabs,
inputStyle: "accessibleTextArea",
// This is because codeMirror queries the underlying textArea for some things that
// can't be retrieved with events in some browser (but we're fine in Firefox).
pollInterval: Math.pow(2, 31) - 1,
styleActiveLine: true,
autoCloseBrackets: "()[]{}''\"\"``",
autoCloseEnabled: useAutoClose,
theme: "mozilla",
themeSwitching: true,
autocomplete: false,
autocompleteOpts: {},
// Expect a CssProperties object (see devtools/client/fronts/css-properties.js)
cssProperties: null,
// Set to true to prevent the search addon to be activated.
disableSearchAddon: false,
maxHighlightLength: 1000,
// Disable codeMirror setTimeout-based cursor blinking (will be replaced by a CSS animation)
cursorBlinkRate: 0,
// List of non-printable chars that will be displayed in the editor, showing their
// unicode version. We only add a few characters to the default list:
// - \u202d LEFT-TO-RIGHT OVERRIDE
// - \u202e RIGHT-TO-LEFT OVERRIDE
// - \u2066 LEFT-TO-RIGHT ISOLATE
// - \u2067 RIGHT-TO-LEFT ISOLATE
// - \u2069 POP DIRECTIONAL ISOLATE
specialChars:
// eslint-disable-next-line no-control-regex
/[\u0000-\u001f\u007f-\u009f\u00ad\u061c\u200b-\u200f\u2028\u2029\u202d\u202e\u2066\u2067\u2069\ufeff\ufff9-\ufffc]/,
specialCharPlaceholder: char => {
// Use the doc provided to the setup function if we don't have a reference to a codeMirror
// editor yet (this can happen when an Editor is being created with existing content)
const doc = this.#ownerDoc;
const el = doc.createElement("span");
el.classList.add("cm-non-printable-char");
el.append(doc.createTextNode(`\\u${char.codePointAt(0).toString(16)}`));
return el;
},
// In CodeMirror 5, adds a `CodeMirror-selectedtext` class on selected text that
// can be used to set the selected text color, which isn't possible by default.
// This is especially useful for High Contrast Mode where we do need to adjust the
// selection text color
styleSelectedText: true,
};
// Additional shortcuts.
this.config.extraKeys[Editor.keyFor("jumpToLine")] = () =>
this.jumpToLine();
this.config.extraKeys[Editor.keyFor("moveLineUp", { noaccel: true })] =
() => this.moveLineUp();
this.config.extraKeys[Editor.keyFor("moveLineDown", { noaccel: true })] =
() => this.moveLineDown();
this.config.extraKeys[Editor.keyFor("toggleComment")] = "toggleComment";
// Disable ctrl-[ and ctrl-] because toolbox uses those shortcuts.
this.config.extraKeys[Editor.keyFor("indentLess")] = false;
this.config.extraKeys[Editor.keyFor("indentMore")] = false;
// Disable Alt-B and Alt-F to navigate groups (respectively previous and next) since:
// - it's not standard in input fields
// - it also inserts a character which feels weird
this.config.extraKeys["Alt-B"] = false;
this.config.extraKeys["Alt-F"] = false;
// Disable Ctrl/Cmd + U as it's used for "View Source". It's okay to disable Ctrl+U as
// the underlying command, `undoSelection`, isn't standard in input fields and isn't
// widely known.
this.config.extraKeys[Editor.accel("U")] = false;
if (!config.disableSearchAddon) {
// Override the default search shortcut so the built-in UI doesn't get hidden
// when hitting Enter (so the user can cycle through results).
this.config.extraKeys[Editor.accel("F")] = () =>
editors.get(this).execCommand("findPersistent");
}
// Disable keys that trigger events with a null-string `which` property.
// It looks like some of those (e.g. the Function key), can trigger a poll
// which fails to see that there's a selection, which end up replacing the
// selected text with an empty string.
// TODO: We should investigate the root cause.
this.config.extraKeys["'\u0000'"] = false;
// Overwrite default config with user-provided, if needed.
Object.keys(config).forEach(k => {
if (k != "extraKeys") {
this.config[k] = config[k];
return;
}
if (!config.extraKeys) {
return;
}
Object.keys(config.extraKeys).forEach(key => {
this.config.extraKeys[key] = config.extraKeys[key];
});
});
if (!this.config.gutters) {
this.config.gutters = [];
}
if (
this.config.lineNumbers &&
!this.config.gutters.includes("CodeMirror-linenumbers")
) {
this.config.gutters.push("CodeMirror-linenumbers");
}
// Remember the initial value of autoCloseBrackets.
this.config.autoCloseBracketsSaved = this.config.autoCloseBrackets;
// If the tab behaviour is not explicitly set to `false` from the config, set a tab behavior.
// If something is selected, indent those lines. If nothing is selected and we're
// indenting with tabs, insert one tab. Otherwise insert N
// whitespaces where N == indentUnit option.
if (this.config.extraKeys.Tab !== false) {
this.config.extraKeys.Tab = cm => {
if (config.extraKeys?.Tab) {
// If a consumer registers its own extraKeys.Tab, we execute it before doing
// anything else. If it returns false, that mean that all the key handling work is
// done, so we can do an early return.
const res = config.extraKeys.Tab(cm);
if (res === false) {
return;
}
}
if (cm.somethingSelected()) {
cm.indentSelection("add");
return;
}
if (this.config.indentWithTabs) {
cm.replaceSelection("\t", "end", "+input");
return;
}
let num = cm.getOption("indentUnit");
if (cm.getCursor().ch !== 0) {
num -= cm.getCursor().ch % num;
}
cm.replaceSelection(" ".repeat(num), "end", "+input");
};
if (this.config.cssProperties) {
// Ensure that autocompletion has cssProperties if it's passed in via the options.
this.config.autocompleteOpts.cssProperties = this.config.cssProperties;
}
}
}
/**
* Exposes the CodeMirror class. We want to be able to
* invoke static commands such as runMode for syntax highlighting.
*/
get CodeMirror() {
const codeMirror = editors.get(this);
return codeMirror?.constructor;
}
/**
* Exposes the CodeMirror instance. We want to get away from trying to
* abstract away the API entirely, and this makes it easier to integrate in
* various environments and do complex things.
*/
get codeMirror() {
if (!editors.has(this)) {
throw new Error(
"CodeMirror instance does not exist. You must wait " +
"for it to be appended to the DOM."
);
}
return editors.get(this);
}
/**
* Return whether there is a CodeMirror instance associated with this Editor.
*/
get hasCodeMirror() {
return editors.has(this);
}
/**
* Appends the current Editor instance to the element specified by
* 'el'. You can also provide your own iframe to host the editor as
* an optional second parameter. This method actually creates and
* loads CodeMirror and all its dependencies.
*
* This method is asynchronous and returns a promise.
*/
appendTo(el, env) {
return new Promise(resolve => {
const cm = editors.get(this);
if (!env) {
env = el.ownerDocument.createElementNS(XHTML_NS, "iframe");
env.className = "source-editor-frame";
}
if (cm) {
throw new Error("You can append an editor only once.");
}
const onLoad = () => {
// Prevent flickering by showing the iframe once loaded.
env.style.visibility = "";
const win = env.contentWindow.wrappedJSObject;
this.container = env;
const editorEl = win.document.body;
const editorDoc = el.ownerDocument;
if (this.config.cm6) {
this.#setupCm6(editorEl, editorDoc);
} else {
this.#setup(editorEl, editorDoc);
}
resolve();
};
env.style.visibility = "hidden";
env.addEventListener("load", onLoad, {
capture: true,
once: true,
signal: this.#abortController?.signal,
});
env.src = CM_IFRAME;
el.appendChild(env);
this.once("destroy", () => el.removeChild(env));
});
}
appendToLocalElement(el) {
const win = el.ownerDocument.defaultView;
this.#abortController = new win.AbortController();
if (this.config.cm6) {
this.#setupCm6(el);
} else {
this.#setup(el);
}
}
// This update listener allows listening to the changes
// to the codemiror editor.
setUpdateListener(listener = null) {
this.#updateListener = listener;
}
/**
* Do the actual appending and configuring of the CodeMirror instance. This is
* used by both append functions above, and does all the hard work to
* configure CodeMirror with all the right options/modes/etc.
*/
#setup(el, doc) {
this.#ownerDoc = doc || el.ownerDocument;
const win = el.ownerDocument.defaultView;
Services.scriptloader.loadSubScript(CM_BUNDLE, win);
this.#win = win;
if (this.config.cssProperties) {
// Replace the propertyKeywords, colorKeywords and valueKeywords
// properties of the CSS MIME type with the values provided by the CSS properties
// database.
const { propertyKeywords, colorKeywords, valueKeywords } = getCSSKeywords(
this.config.cssProperties
);
const cssSpec = win.CodeMirror.resolveMode("text/css");
cssSpec.propertyKeywords = propertyKeywords;
cssSpec.colorKeywords = colorKeywords;
cssSpec.valueKeywords = valueKeywords;
win.CodeMirror.defineMIME("text/css", cssSpec);
const scssSpec = win.CodeMirror.resolveMode("text/x-scss");
scssSpec.propertyKeywords = propertyKeywords;
scssSpec.colorKeywords = colorKeywords;
scssSpec.valueKeywords = valueKeywords;
win.CodeMirror.defineMIME("text/x-scss", scssSpec);
}
win.CodeMirror.commands.save = () => this.emit("saveRequested");
// Create a CodeMirror instance add support for context menus,
// overwrite the default controller (otherwise items in the top and
// context menus won't work).
const cm = win.CodeMirror(el, this.config);
this.Doc = win.CodeMirror.Doc;
// Disable APZ for source editors. It currently causes the line numbers to
// "tear off" and swim around on top of the content. Bug 1160601 tracks
// finding a solution that allows APZ to work with CodeMirror.
cm.getScrollerElement().addEventListener(
"wheel",
ev => {
// By handling the wheel events ourselves, we force the platform to
// scroll synchronously, like it did before APZ. However, we lose smooth
// scrolling for users with mouse wheels. This seems acceptible vs.
// doing nothing and letting the gutter slide around.
ev.preventDefault();
let { deltaX, deltaY } = ev;
if (ev.deltaMode == ev.DOM_DELTA_LINE) {
deltaX *= cm.defaultCharWidth();
deltaY *= cm.defaultTextHeight();
} else if (ev.deltaMode == ev.DOM_DELTA_PAGE) {
deltaX *= cm.getWrapperElement().clientWidth;
deltaY *= cm.getWrapperElement().clientHeight;
}
cm.getScrollerElement().scrollBy(deltaX, deltaY);
},
{ signal: this.#abortController?.signal }
);
cm.getWrapperElement().addEventListener(
"contextmenu",
ev => {
if (!this.config.contextMenu) {
return;
}
ev.stopPropagation();
ev.preventDefault();
let popup = this.config.contextMenu;
if (typeof popup == "string") {
popup = this.#ownerDoc.getElementById(this.config.contextMenu);
}
this.emit("popupOpen", ev, popup);
popup.openPopupAtScreen(ev.screenX, ev.screenY, true);
},
{ signal: this.#abortController?.signal }
);
const pipedEvents = [
"beforeChange",
"blur",
"changes",
"cursorActivity",
"focus",
"keyHandled",
"scroll",
];
for (const eventName of pipedEvents) {
cm.on(eventName, (...args) => this.emit(eventName, ...args));
}
cm.on("change", () => {
this.emit("change");
if (!this.#lastDirty) {
this.#lastDirty = true;
this.emit("dirty-change");
}
});
cm.on("gutterClick", (cmArg, line, gutter, ev) => {
const lineOrOffset = !this.isWasm ? line : this.lineToWasmOffset(line);
this.emit("gutterClick", lineOrOffset, ev.button);
});
win.CodeMirror.defineExtension("l10n", name => {
return L10N.getStr(name);
});
if (!this.config.disableSearchAddon) {
this.#initSearchShortcuts(win);
} else {
// Hotfix for Bug 1527898. We should remove those overrides as part of Bug 1527903.
Object.assign(win.CodeMirror.commands, {
find: null,
findPersistent: null,
findPersistentNext: null,
findPersistentPrev: null,
findNext: null,
findPrev: null,
clearSearch: null,
replace: null,
replaceAll: null,
});
}
// Retrieve the cursor blink rate from user preference, or fall back to CodeMirror's
// default value.
let cursorBlinkingRate = win.CodeMirror.defaults.cursorBlinkRate;
if (Services.prefs.prefHasUserValue(CARET_BLINK_TIME)) {
cursorBlinkingRate = Services.prefs.getIntPref(
CARET_BLINK_TIME,
cursorBlinkingRate
);
}
// This will be used in the animation-duration property we set on the cursor to
// implement the blinking animation. If cursorBlinkingRate is 0 or less, the cursor
// won't blink.
cm.getWrapperElement().style.setProperty(
"--caret-blink-time",
`${Math.max(0, cursorBlinkingRate)}ms`
);
editors.set(this, cm);
this.reloadPreferences = this.reloadPreferences.bind(this);
this.setKeyMap = this.setKeyMap.bind(this, win);
this.#prefObserver = new PrefObserver("devtools.editor.");
this.#prefObserver.on(TAB_SIZE, this.reloadPreferences);
this.#prefObserver.on(EXPAND_TAB, this.reloadPreferences);
this.#prefObserver.on(AUTO_CLOSE, this.reloadPreferences);
this.#prefObserver.on(AUTOCOMPLETE, this.reloadPreferences);
this.#prefObserver.on(DETECT_INDENT, this.reloadPreferences);
this.#prefObserver.on(ENABLE_CODE_FOLDING, this.reloadPreferences);
this.reloadPreferences();
// Init a map of the loaded keymap files. Should be of the form Map<String->Boolean>.
this.#loadedKeyMaps = new Set();
this.#prefObserver.on(KEYMAP_PREF, this.setKeyMap);
this.setKeyMap();
win.editor = this;
const editorReadyEvent = new win.CustomEvent("editorReady");
win.dispatchEvent(editorReadyEvent);
}
#setupLanguageModes() {
if (!this.config.cm6) {
return;
}
const { codemirrorLangJavascript } = this.#CodeMirror6;
this.#languageModes.set(
Editor.modes.js.name,
codemirrorLangJavascript.javascript()
);
}
/**
* Do the actual appending and configuring of the CodeMirror 6 instance.
* This is used by appendTo and appendToLocalElement, and does all the hard work to
* configure CodeMirror 6 with all the right options/modes/etc.
* This should be kept in sync with #setup.
*
* @param {Element} el: Element into which the codeMirror editor should be appended.
* @param {Document} document: Optional document, if not set, will default to el.ownerDocument
*/
#setupCm6(el, doc) {
this.#ownerDoc = doc || el.ownerDocument;
const win = el.ownerDocument.defaultView;
this.#win = win;
this.#CodeMirror6 = this.#win.ChromeUtils.importESModule(
"resource://devtools/client/shared/sourceeditor/codemirror6/codemirror6.bundle.mjs",
{ global: "current" }
);
const {
codemirror,
codemirrorView: {
drawSelection,
EditorView,
keymap,
lineNumbers,
placeholder,
},
codemirrorState: { EditorState, Compartment, Prec },
codemirrorSearch: { highlightSelectionMatches },
codemirrorLanguage: {
syntaxTreeAvailable,
indentUnit,
codeFolding,
syntaxHighlighting,
bracketMatching,
},
lezerHighlight,
} = this.#CodeMirror6;
const tabSizeCompartment = new Compartment();
const indentCompartment = new Compartment();
const lineWrapCompartment = new Compartment();
const lineNumberCompartment = new Compartment();
const lineNumberMarkersCompartment = new Compartment();
const searchHighlightCompartment = new Compartment();
const domEventHandlersCompartment = new Compartment();
const foldGutterCompartment = new Compartment();
const languageCompartment = new Compartment();
this.#compartments = {
tabSizeCompartment,
indentCompartment,
lineWrapCompartment,
lineNumberCompartment,
lineNumberMarkersCompartment,
searchHighlightCompartment,
domEventHandlersCompartment,
foldGutterCompartment,
languageCompartment,
};
const { lineContentMarkerEffect, lineContentMarkerExtension } =
this.#createlineContentMarkersExtension();
const { positionContentMarkerEffect, positionContentMarkerExtension } =
this.#createPositionContentMarkersExtension();
this.#effects = { lineContentMarkerEffect, positionContentMarkerEffect };
const indentStr = (this.config.indentWithTabs ? "\t" : " ").repeat(
this.config.indentUnit || 2
);
// Track the scroll snapshot for the current document at the end of the scroll
this.#editorDOMEventHandlers.scroll = [
debounce(this.#cacheScrollSnapshot, 250),
];
this.#setupLanguageModes();
const languageMode = [];
if (this.config.mode && this.#languageModes.has(this.config.mode.name)) {
languageMode.push(this.#languageModes.get(this.config.mode.name));
}
const extensions = [
bracketMatching(),
indentCompartment.of(indentUnit.of(indentStr)),
tabSizeCompartment.of(EditorState.tabSize.of(this.config.tabSize)),
lineWrapCompartment.of(
this.config.lineWrapping ? EditorView.lineWrapping : []
),
EditorState.readOnly.of(this.config.readOnly),
lineNumberCompartment.of(this.config.lineNumbers ? lineNumbers() : []),
codeFolding({
placeholderText: "↔",
}),
foldGutterCompartment.of([]),
syntaxHighlighting(lezerHighlight.classHighlighter),
EditorView.updateListener.of(v => {
if (!cm.isDocumentLoadComplete) {
// Check that the full syntax tree is available the current viewport
if (syntaxTreeAvailable(v.state, v.view.viewState.viewport.to)) {
cm.isDocumentLoadComplete = true;
}
}
if (v.viewportChanged || v.docChanged) {
if (v.docChanged) {
cm.isDocumentLoadComplete = false;
}
// reset line gutter markers for the new visible ranges
// when the viewport changes(e.g when the page is scrolled).
if (this.#lineGutterMarkers.size > 0) {
this.setLineGutterMarkers();
}
}
// Any custom defined update listener should be called
if (typeof this.#updateListener == "function") {
this.#updateListener(v);
}
}),
domEventHandlersCompartment.of(
EditorView.domEventHandlers(this.#createEventHandlers())
),
lineNumberMarkersCompartment.of([]),
lineContentMarkerExtension,
positionContentMarkerExtension,
searchHighlightCompartment.of(this.#searchHighlighterExtension([])),
languageCompartment.of(languageMode),
highlightSelectionMatches(),
// keep last so other extension take precedence
codemirror.minimalSetup,
];
if (this.config.placeholder) {
extensions.push(placeholder(this.config.placeholder));
}
if (this.config.keyMap) {
extensions.push(Prec.highest(keymap.of(this.config.keyMap)));
}
if (Services.prefs.prefHasUserValue(CARET_BLINK_TIME)) {
// We need to multiply the preference value by 2 to match Firefox cursor rate
const cursorBlinkRate = Services.prefs.getIntPref(CARET_BLINK_TIME) * 2;
extensions.push(
drawSelection({
cursorBlinkRate,
})
);
}
const cm = new EditorView({
parent: el,
extensions,
});
cm.isDocumentLoadComplete = false;
editors.set(this, cm);
// For now, we only need to pipe the blur event
cm.contentDOM.addEventListener("blur", e => this.emit("blur", e), {
signal: this.#abortController?.signal,
});
}
/**
* This creates the extension which handles marking of lines within the editor.
*
* @returns {Object} The object contains an extension and effects which used to trigger updates to the extension
* {Object} - lineContentMarkerExtension - The line content marker extension
* {Object} - lineContentMarkerEffect - The effects to add and remove markers
*
*/
#createlineContentMarkersExtension() {
const {
codemirrorView: { Decoration, WidgetType, EditorView },
codemirrorState: { StateField, StateEffect },
} = this.#CodeMirror6;
const lineContentMarkers = this.#lineContentMarkers;
class LineContentWidget extends WidgetType {
constructor(line, value, markerId, createElementNode) {
super();
this.line = line;
this.value = value;
this.markerId = markerId;
this.createElementNode = createElementNode;
}
toDOM() {
return this.createElementNode(this.line, this.value);
}
eq(widget) {
return (
widget.line == this.line &&
widget.markerId == this.markerId &&
widget.value == this.value
);
}
}
/**
* Uses the marker and current decoration list to create a new decoration list
*
* @param {Object} marker - The marker to be used to create the new decoration
* @param {Transaction} transaction - The transaction object
* @param {Array} newMarkerDecorations - List of the new marker decorations being built
*/
function _buildDecorationsForMarker(
marker,
transaction,
newMarkerDecorations
) {
const vStartLine = transaction.state.doc.lineAt(
marker._view.viewport.from
);
const vEndLine = transaction.state.doc.lineAt(marker._view.viewport.to);
let decorationLines;
if (marker.shouldMarkAllLines) {
decorationLines = [];
for (let i = vStartLine.number; i <= vEndLine.number; i++) {
decorationLines.push({ line: i });
}
} else {
decorationLines = marker.lines;
}
for (const { line, value } of decorationLines) {
// Make sure the position is within the viewport
if (line < vStartLine.number || line > vEndLine.number) {
continue;
}
const lo = transaction.state.doc.line(line);
if (marker.lineClassName) {
// Markers used:
// 1) blackboxed-line-marker
// 2) multi-highlight-line-marker
// 3) highlight-line-marker
// 4) line-exception-marker
// 5) debug-line-marker
const classDecoration = Decoration.line({
class: marker.lineClassName,
});
classDecoration.markerType = marker.id;
newMarkerDecorations.push(classDecoration.range(lo.from));
} else if (marker.createLineElementNode) {
// Markers used:
// 1) conditional-breakpoint-panel-marker
// 2) inline-preview-marker
const nodeDecoration = Decoration.widget({
widget: new LineContentWidget(
line,
value,
marker.id,
marker.createLineElementNode
),
// Render the widget after the cursor
side: 1,
block: !!marker.renderAsBlock,
});
nodeDecoration.markerType = marker.id;
newMarkerDecorations.push(nodeDecoration.range(lo.to));
}
}
}
/**
* This updates the decorations for the marker specified
*
* @param {Array} markerDecorations - The current decorations displayed in the document
* @param {Array} marker - The current marker whose decoration should be update
* @param {Transaction} transaction
* @returns
*/
function updateDecorations(markerDecorations, marker, transaction) {
const newDecorations = [];
_buildDecorationsForMarker(marker, transaction, newDecorations);
return markerDecorations.update({
// Filter out old decorations for the specified marker
filter: (from, to, decoration) => {
return decoration.markerType !== marker.id;
},
add: newDecorations,
sort: true,
});
}
/**
* This updates all the decorations for all the markers. This
* used in scenarios when an update to view (e.g vertically scrolling into a new viewport)
* requires all the marker decoraions.
*
* @param {Array} markerDecorations - The current decorations displayed in the document
* @param {Array} allMarkers - All the cached markers
* @param {Object} transaction
* @returns
*/
function updateDecorationsForAllMarkers(
markerDecorations,
allMarkers,
transaction
) {
const allNewDecorations = [];
for (const marker of allMarkers) {
_buildDecorationsForMarker(marker, transaction, allNewDecorations);
}
return markerDecorations.update({
// This filters out all the old decorations
filter: () => false,
add: allNewDecorations,
sort: true,
});
}
function removeDecorations(markerDecorations, markerId) {
return markerDecorations.update({
filter: (from, to, decoration) => {
return decoration.markerType !== markerId;
},
});
}
// The effects used to create the transaction when markers are
// either added and removed.
const addEffect = StateEffect.define();
const removeEffect = StateEffect.define();
const lineContentMarkerExtension = StateField.define({
create() {
return Decoration.none;
},
update(markerDecorations, transaction) {
// Map the decorations through the transaction changes, this is important
// as it remaps the decorations from positions in the old document to
// positions in the new document.
markerDecorations = markerDecorations.map(transaction.changes);
for (const effect of transaction.effects) {
// When a new marker is added
if (effect.is(addEffect)) {
markerDecorations = updateDecorations(
markerDecorations,
effect.value,
transaction
);
} else if (effect.is(removeEffect)) {
// when a marker is removed
markerDecorations = removeDecorations(
markerDecorations,
effect.value
);
} else {
const cachedMarkers = lineContentMarkers.values();
// For updates that are not related to this marker decoration,
// we want to update the decorations when the editor is scrolled
// and a new viewport is loaded.
markerDecorations = updateDecorationsForAllMarkers(
markerDecorations,
cachedMarkers,
transaction
);
}
}
return markerDecorations;
},
provide: field => EditorView.decorations.from(field),
});
return {
lineContentMarkerExtension,
lineContentMarkerEffect: { addEffect, removeEffect },
};
}
#createEventHandlers() {
const eventHandlers = {};
for (const eventName in this.#editorDOMEventHandlers) {
const handlers = this.#editorDOMEventHandlers[eventName];
eventHandlers[eventName] = (event, editor) => {
if (!event.target) {
return;
}
for (const handler of handlers) {
// Wait a cycle so the codemirror updates to the current cursor position,
// information, TODO: Currently noticed this issue with CM6, not ideal but should
// investigate further Bug 1890895.
event.target.ownerGlobal.setTimeout(() => {
const view = editor.viewState;
const cursorPos = lezerUtils.positionToLocation(
view.state.doc,
view.state.selection.main.head
);
handler(event, view, cursorPos.line, cursorPos.column);
}, 0);
}
};
}
return eventHandlers;
}
/**
* Adds the DOM event handlers for the editor.
* @param {Object} domEventHandlers - A dictionary of handlers for the DOM events
* the handlers are getting called with the following arguments
* - {Object} `event`: The DOM event
* - {Object} `view`: The codemirror view
* - {Number} cursorLine`: The line where the cursor is currently position
* - {Number} `cursorColumn`: The column where the cursor is currently position
* - {Number} `eventLine`: The line where the event was fired.
* This might be different from the cursor line for mouse events.
* - {Number} `eventColumn`: The column where the event was fired.
* This might be different from the cursor column for mouse events.
*/
addEditorDOMEventListeners(domEventHandlers) {
const cm = editors.get(this);
const {
codemirrorView: { EditorView },
} = this.#CodeMirror6;
// Update the cache of dom event handlers
for (const eventName in domEventHandlers) {
if (!this.#editorDOMEventHandlers[eventName]) {
this.#editorDOMEventHandlers[eventName] = [];
}
this.#editorDOMEventHandlers[eventName].push(domEventHandlers[eventName]);
}
cm.dispatch({
effects: this.#compartments.domEventHandlersCompartment.reconfigure(
EditorView.domEventHandlers(this.#createEventHandlers())
),
});
}
#cacheScrollSnapshot = () => {
const cm = editors.get(this);
if (!this.#currentDocumentId) {
return;
}
this.#scrollSnapshots.set(this.#currentDocumentId, cm.scrollSnapshot());
this.emitForTests("cm-editor-scrolled");
};
/**
* Remove specified DOM event handlers for the editor.
* @param {Object} domEventHandlers - A dictionary of handlers for the DOM events
*/
removeEditorDOMEventListeners(domEventHandlers) {
const cm = editors.get(this);
const {
codemirrorView: { EditorView },
} = this.#CodeMirror6;
for (const eventName in domEventHandlers) {
const domEventHandler = domEventHandlers[eventName];
const cachedEventHandlers = this.#editorDOMEventHandlers[eventName];
if (!domEventHandler || !cachedEventHandlers) {
continue;
}
const index = cachedEventHandlers.findIndex(
handler => handler == domEventHandler
);
this.#editorDOMEventHandlers[eventName].splice(index, 1);
}
cm.dispatch({
effects: this.#compartments.domEventHandlersCompartment.reconfigure(
EditorView.domEventHandlers(this.#createEventHandlers())
),
});
}
/**
* Clear the DOM event handlers for the editor.
*/
#clearEditorDOMEventListeners() {
const cm = editors.get(this);
const {
codemirrorView: { EditorView },
} = this.#CodeMirror6;
this.#editorDOMEventHandlers = {};
this.#gutterDOMEventHandlers = {};
cm.dispatch({
effects: this.#compartments.domEventHandlersCompartment.reconfigure(
EditorView.domEventHandlers({})
),
});
}
/**
* This adds a marker used to add classes to editor line based on a condition.
* @property {object} marker
* The rule rendering a marker or class.
* @property {object} marker.id
* The unique identifier for this marker
* @property {string} marker.lineClassName
* The css class to apply to the line
* @property {Array<Object>} marker.lines
* The lines to add markers to. Each line object has a `line` and `value` property.
* @property {Boolean} marker.renderAsBlock
* The specifies that the widget should be rendered as a block element. defaults to `false`. This is optional.
* @property {Boolean} marker.shouldMarkAllLines
* Set to true to apply the marker to all the lines. In such case, `positions` is ignored. This is optional.
* @property {Function} marker.createLineElementNode
* This should return the DOM element which is used for the marker. The line number is passed as a parameter.
* This is optional.
*/
setLineContentMarker(marker) {
const cm = editors.get(this);
// We store the marker an the view state, this is gives access to view data
// when defining updates to the StateField.
marker._view = cm;
this.#lineContentMarkers.set(marker.id, marker);
cm.dispatch({
effects: this.#effects.lineContentMarkerEffect.addEffect.of(marker),
});
}
/**
* This removes the marker which has the specified className
* @param {string} markerId - The unique identifier for this marker
*/
removeLineContentMarker(markerId) {
const cm = editors.get(this);
this.#lineContentMarkers.delete(markerId);
cm.dispatch({
effects: this.#effects.lineContentMarkerEffect.removeEffect.of(markerId),
});
}
/**
* This creates the extension used to manage the rendering of markers
* at specific positions with the editor. e.g used for column breakpoints
*
* @returns {Object} The object contains an extension and effects which used to trigger updates to the extension
* {Object} - positionContentMarkerExtension - The position content marker extension
* {Object} - positionContentMarkerEffect - The effects to add and remove markers
*/
#createPositionContentMarkersExtension() {
const {
codemirrorView: { Decoration, EditorView, WidgetType },
codemirrorState: { StateField, StateEffect },
codemirrorLanguage: { syntaxTree },
} = this.#CodeMirror6;
const cachedPositionContentMarkers = this.#posContentMarkers;
class NodeWidget extends WidgetType {
constructor({
line,
column,
isFirstNonSpaceColumn,
positionData,
markerId,
createElementNode,
customEq,
}) {
super();
this.line = line;
this.column = column;
this.isFirstNonSpaceColumn = isFirstNonSpaceColumn;
this.positionData = positionData;
this.markerId = markerId;
this.customEq = customEq;
this.toDOM = () =>
createElementNode(line, column, isFirstNonSpaceColumn, positionData);
}
eq(widget) {
let eq =
this.line == widget.line &&
this.column == widget.column &&
this.markerId == widget.markerId;
if (this.positionData && this.customEq) {
eq = eq && this.customEq(this.positionData, widget.positionData);
}
return eq;
}
}
function getIndentation(lineText) {
if (!lineText) {
return 0;
}
const lineMatch = lineText.match(/^\s*/);
if (!lineMatch) {
return 0;
}
return lineMatch[0].length;
}
function _buildDecorationsForPositionMarkers(
marker,
transaction,
newMarkerDecorations
) {
const viewport = marker._view.viewport;
const vStartLine = transaction.state.doc.lineAt(viewport.from);
const vEndLine = transaction.state.doc.lineAt(viewport.to);
for (const position of marker.positions) {
// If codemirror positions are provided (e.g from search cursor)
// compare that directly.
if (position.from && position.to) {
if (position.from >= viewport.from && position.to <= viewport.to) {
if (marker.positionClassName) {
// Markers used:
// 1. active-selection-marker
const classDecoration = Decoration.mark({
class: marker.positionClassName,
});
classDecoration.markerType = marker.id;
newMarkerDecorations.push(
classDecoration.range(position.from, position.to)
);
}
}
continue;
}
// If line and column are provided
if (
position.line >= vStartLine.number &&
position.line <= vEndLine.number
) {
const line = transaction.state.doc.line(position.line);
// Make sure to track any indentation at the beginning of the line
const column = Math.max(position.column, getIndentation(line.text));
const pos = line.from + column;
if (marker.createPositionElementNode) {
// Markers used:
// 1. column-breakpoint-marker
const isFirstNonSpaceColumn = ONLY_SPACES_REGEXP.test(
line.text.substr(0, column)
);
const nodeDecoration = Decoration.widget({
widget: new NodeWidget({
line: position.line,
column: position.column,
isFirstNonSpaceColumn,
positionData: position.positionData,
markerId: marker.id,
createElementNode: marker.createPositionElementNode,
customEq: marker.customEq,
}),
// Make sure the widget is rendered after the cursor
side: 1,
});
nodeDecoration.markerType = marker.id;
newMarkerDecorations.push(nodeDecoration.range(pos, pos));
}
if (marker.positionClassName) {
// Markers used:
// 1. exception-position-marker
// 2. debug-position-marker
const tokenAtPos = syntaxTree(transaction.state).resolve(pos, 1);
// While trying to update the markers, during content changes, the syntax tree is not
// guaranteed to be complete, so there is the possibility of getting wrong `from` and `to` values for the token.
// To make sure we are handling a valid token, let's check that the `from` value (which is the start position of the retrieved token)
// matches the position we want.
if (tokenAtPos.from !== pos) {
continue;
}
const tokenString = line.text.slice(
position.column,
tokenAtPos.to - line.from
);
// Ignore any empty strings and opening braces
if (
tokenString === "" ||
tokenString === "{" ||
tokenString === "["
) {
continue;
}
const classDecoration = Decoration.mark({
class: marker.positionClassName,
});
classDecoration.markerType = marker.id;
newMarkerDecorations.push(
classDecoration.range(pos, tokenAtPos.to)
);
}
}
}
}
/**
* This updates the decorations for the marker specified
*
* @param {Array} markerDecorations - The current decorations displayed in the document
* @param {Array} marker - The current marker whose decoration should be update
* @param {Transaction} transaction
* @returns
*/
function updateDecorations(markerDecorations, marker, transaction) {
const newDecorations = [];
_buildDecorationsForPositionMarkers(marker, transaction, newDecorations);
return markerDecorations.update({
filter: (from, to, decoration) => {
return decoration.markerType !== marker.id;
},
add: newDecorations,
sort: true,
});
}
/**
* This updates all the decorations for all the markers. This
* used in scenarios when an update to view (e.g vertically scrolling into a new viewport)
* requires all the marker decoraions.
*
* @param {Array} markerDecorations - The current decorations displayed in the document
* @param {Array} markers - All the cached markers
* @param {Object} transaction
* @returns
*/
function updateDecorationsForAllMarkers(
markerDecorations,
markers,
transaction
) {
const allNewDecorations = [];
// Sort the markers iterator thanks to `displayLast` boolean.
// This is typically used by the paused location marker to be shown after the column breakpoints.
markers = Array.from(markers).sort((a, b) => {
if (a.displayLast) {
return 1;
}
if (b.displayLast) {
return -1;
}
return 0;
});
for (const marker of markers) {
_buildDecorationsForPositionMarkers(
marker,
transaction,
allNewDecorations
);
}
return markerDecorations.update({
filter: () => false,
add: allNewDecorations,
sort: true,
});
}
function removeDecorations(markerDecorations, markerId) {
return markerDecorations.update({
filter: (from, to, decoration) => {
return decoration.markerType !== markerId;
},
});
}
const addEffect = StateEffect.define();
const removeEffect = StateEffect.define();
const positionContentMarkerExtension = StateField.define({
create() {
return Decoration.none;
},
update(markerDecorations, transaction) {
// Map the decorations through the transaction changes, this is important
// as it remaps the decorations from positions in the old document to
// positions in the new document.
markerDecorations = markerDecorations.map(transaction.changes);
for (const effect of transaction.effects) {
if (effect.is(addEffect)) {
// When a new marker is added
markerDecorations = updateDecorations(
markerDecorations,
effect.value,
transaction
);
} else if (effect.is(removeEffect)) {
// When a marker is removed
markerDecorations = removeDecorations(
markerDecorations,
effect.value
);
} else {
// For updates that are not related to this marker decoration,
// we want to update the decorations when the editor is scrolled
// and a new viewport is loaded.
markerDecorations = updateDecorationsForAllMarkers(
markerDecorations,
cachedPositionContentMarkers.values(),
transaction
);
}
}
return markerDecorations;
},
provide: field => EditorView.decorations.from(field),
});
return {
positionContentMarkerExtension,
positionContentMarkerEffect: { addEffect, removeEffect },
};
}
/**
* This adds a marker used to decorate token / content at a specific position .
* @param {Object} marker
* @param {String} marker.id
* @param {Array<Object>} marker.positions - This includes the line / column and any optional positionData which defines each position.
* @param {Function} marker.createPositionElementNode - This describes how to render the marker.
* The position data (i.e line, column and positionData) are passed as arguments.
* @param {Function} marker.customEq - A custom function to determine the equality of the marker. This allows the user define special conditions
* for when position details have changed and an update of the marker should happen.
* The positionData defined for the current and the previous instance of the marker are passed as arguments.
*/
setPositionContentMarker(marker) {
const cm = editors.get(this);
// We store the marker an the view state, this is gives access to viewport data
// when defining updates to the StateField.
marker._view = cm;
this.#posContentMarkers.set(marker.id, marker);
cm.dispatch({
effects: this.#effects.positionContentMarkerEffect.addEffect.of(marker),
});
}
/**
* This removes the marker which has the specified id
* @param {string} markerId - The unique identifier for this marker
*/
removePositionContentMarker(markerId) {
const cm = editors.get(this);
this.#posContentMarkers.delete(markerId);
cm.dispatch({
effects:
this.#effects.positionContentMarkerEffect.removeEffect.of(markerId),
});
}
/**
* Set event listeners for the line gutter
* @param {Object} domEventHandlers
*
* example usage:
* const domEventHandlers = { click(event) { console.log(event);} }
*/
setGutterEventListeners(domEventHandlers) {
const cm = editors.get(this);
const {
codemirrorView: { lineNumbers },
codemirrorLanguage: { foldGutter },
} = this.#CodeMirror6;
for (const eventName in domEventHandlers) {
const handler = domEventHandlers[eventName];
this.#gutterDOMEventHandlers[eventName] = (view, line, event) => {
line = view.state.doc.lineAt(line.from);
handler(event, view, line.number);
};
}
cm.dispatch({
effects: [
this.#compartments.lineNumberCompartment.reconfigure(
lineNumbers({ domEventHandlers: this.#gutterDOMEventHandlers })
),
this.#compartments.foldGutterCompartment.reconfigure(
foldGutter({
class: "cm6-dt-foldgutter",
markerDOM: open => {
if (!this.#ownerDoc) {
return null;
}
const button = this.#ownerDoc.createElement("button");
button.classList.add("cm6-dt-foldgutter__toggle-button");
button.setAttribute("aria-expanded", open);
return button;
},
domEventHandlers: this.#gutterDOMEventHandlers,
})
),
],
});
}
/**
* This supports adding/removing of line classes or markers on the
* line number gutter based on the defined conditions. This only supports codemirror 6.
*
* @param {Array<Marker>} markers - The list of marker objects which defines the rules
* for rendering each marker.
* @property {object} marker - The rule rendering a marker or class. This is required.
* @property {string} marker.id - The unique identifier for this marker.
* @property {string} marker.lineClassName - The css class to add to the line. This is required.
* @property {function} marker.condition - The condition that decides if the marker/class gets added or removed.
* This should return `false` for lines where the marker should not be added and the
* result of the condition for any other line.
* @property {function=} marker.createLineElementNode - This gets the line and the result of the condition as arguments and should return the DOM element which
* is used for the marker. This is optional.
*/
setLineGutterMarkers(markers) {
const cm = editors.get(this);
if (markers) {
// Cache the markers for use later. See next comment
for (const marker of markers) {
if (!marker.id) {
throw new Error("Marker has no unique identifier");
}
this.#lineGutterMarkers.set(marker.id, marker);
}
}
// When no markers are passed, the cached markers are used to update the line gutters.
// This is useful for re-rendering the line gutters when the viewport changes
// (note: the visible ranges will be different) in this case, mainly when the editor is scrolled.
else if (!this.#lineGutterMarkers.size) {
return;
}
markers = Array.from(this.#lineGutterMarkers.values());
const {
codemirrorView: { lineNumberMarkers, GutterMarker },
codemirrorState: { RangeSetBuilder },
} = this.#CodeMirror6;
// This creates a new GutterMarker https://codemirror.net/docs/ref/#view.GutterMarker
// to represents how each line gutter is rendered in the view.
// This is set as the value for the Range https://codemirror.net/docs/ref/#state.Range
// which represents the line.
class LineGutterMarker extends GutterMarker {
constructor(className, lineNumber, createElementNode, conditionResult) {
super();
this.elementClass = className || null;
this.lineNumber = lineNumber;
this.createElementNode = createElementNode;
this.conditionResult = conditionResult;
this.toDOM = createElementNode
? () => createElementNode(lineNumber, conditionResult)
: null;
}
eq(marker) {
return (
marker.lineNumber == this.lineNumber &&
marker.conditionResult == this.conditionResult
);
}
}
// (representing the lines in the current viewport) and generate a new rangeset for updating the line gutter
// based on the conditions defined in the markers(for each line) provided.
const builder = new RangeSetBuilder();
const { from, to } = cm.viewport;
let pos = from;
while (pos <= to) {
const line = cm.state.doc.lineAt(pos);
for (const {
lineClassName,
condition,
createLineElementNode,
} of markers) {
if (typeof condition !== "function") {
throw new Error("The `condition` is not a valid function");
}
const conditionResult = condition(line.number);
if (conditionResult !== false) {
builder.add(
line.from,
line.to,
new LineGutterMarker(
lineClassName,
line.number,
createLineElementNode,
conditionResult
)
);
}
}
pos = line.to + 1;
}
// To update the state with the newly generated marker range set, a dispatch is called on the view
// with an transaction effect created by the lineNumberMarkersCompartment, which is used to update the
// lineNumberMarkers extension configuration.
cm.dispatch({
effects: this.#compartments.lineNumberMarkersCompartment.reconfigure(
lineNumberMarkers.of(builder.finish())
),
});
}
/**
* This creates the extension used to manage the rendering of markers for
* results for any search pattern
* @param {RegExp} pattern - The search pattern
* @param {String} className - The class used to decorate each result
* @returns {Array<ViewPlugin>} An extension which is an array containing the view
* which manages the rendering of the line content markers.
*/
#searchHighlighterExtension({
/* This defaults to matching nothing */ pattern = /.^/g,
className = "",
}) {
const cm = editors.get(this);
if (!cm) {
return [];
}
const {
codemirrorView: { Decoration, ViewPlugin, EditorView, MatchDecorator },
codemirrorSearch: { RegExpCursor },
} = this.#CodeMirror6;
this.searchState.query = pattern;
const searchCursor = new RegExpCursor(cm.state.doc, pattern, {
ignoreCase: pattern.ignoreCase,
});
this.searchState.cursors = Array.from(searchCursor);
this.searchState.currentCursorIndex = -1;
const patternMatcher = new MatchDecorator({
regexp: pattern,
decorate: (add, from, to) => {
add(from, to, Decoration.mark({ class: className }));
},
});
const searchHighlightView = ViewPlugin.fromClass(
class {
decorations;
constructor(view) {
this.decorations = patternMatcher.createDeco(view);
}
update(viewUpdate) {
this.decorations = patternMatcher.updateDeco(
viewUpdate,
this.decorations
);
}
},
{
decorations: instance => instance.decorations,
provide: plugin =>
EditorView.atomicRanges.of(view => {
return view.plugin(plugin)?.decorations || Decoration.none;
}),
}
);
return [searchHighlightView];
}
/**
* This should add the class to the results of a search pattern specified
*
* @param {RegExp} pattern - The search pattern
* @param {String} className - The class used to decorate each result
*/
highlightSearchMatches(pattern, className) {
const cm = editors.get(this);
cm.dispatch({
effects: this.#compartments.searchHighlightCompartment.reconfigure(
this.#searchHighlighterExtension({ pattern, className })
),
});
}
/**
* This clear any decoration on all the search results
*/
clearSearchMatches() {
this.highlightSearchMatches(undefined, "");
}
/**
* Retrieves the cursor for the next selection to be highlighted
*
* @param {Boolean} reverse - Determines the direction of the cursor movement
* @returns {RegExpSearchCursor}
*/
getNextSearchCursor(reverse) {
if (reverse) {
if (this.searchState.currentCursorIndex == 0) {
this.searchState.currentCursorIndex =
this.searchState.cursors.length - 1;
} else {
this.searchState.currentCursorIndex--;
}
} else if (
this.searchState.currentCursorIndex ==
this.searchState.cursors.length - 1
) {
this.searchState.currentCursorIndex = 0;
} else {
this.searchState.currentCursorIndex++;
}
return this.searchState.cursors[this.searchState.currentCursorIndex];
}
/**
* Get the start and end locations of the current viewport
*
* @param {Number} offsetHorizontalCharacters - Offset of characters offscreen
* @param {Number} offsetVerticalLines - Offset of lines offscreen
* @returns {Object} - The location information for the current viewport
*/
getLocationsInViewport(
offsetHorizontalCharacters = 0,
offsetVerticalLines = 0
) {
if (this.isDestroyed()) {
return null;
}
const cm = editors.get(this);
let startLine, endLine, scrollLeft, charWidth, rightPosition;
if (this.config.cm6) {
// Report no viewport until we show an actual source (and not a loading/error message)
if (!this.#currentDocumentId) {
return null;
}
const { from, to } = cm.viewport;
startLine = cm.state.doc.lineAt(from).number - offsetVerticalLines;
endLine = cm.state.doc.lineAt(to).number + offsetVerticalLines;
scrollLeft = cm.scrollDOM.scrollLeft;
charWidth = cm.defaultCharacterWidth;
rightPosition = scrollLeft + cm.dom.getBoundingClientRect().width;
} else {
if (!cm) {
return null;
}
const scrollArea = cm.getScrollInfo();
const rect = cm.getWrapperElement().getBoundingClientRect();
startLine = cm.lineAtHeight(rect.top, "window") - offsetVerticalLines;
endLine = cm.lineAtHeight(rect.bottom, "window") + offsetVerticalLines;
scrollLeft = cm.doc.scrollLeft;
charWidth = cm.defaultCharWidth();
rightPosition = scrollLeft + (scrollArea.clientWidth - 30);
}
return {
start: {
line: startLine,
column:
scrollLeft > 0
? Math.floor(scrollLeft / charWidth) - offsetHorizontalCharacters
: 0,
},
end: {
line: endLine,
column:
Math.floor(rightPosition / charWidth) + offsetHorizontalCharacters,
},
};
}
/**
* Gets the position information for the current selection
* @returns {Object} cursor - The location information for the current selection
* cursor.from - An object with the starting line / column of the selection
* cursor.to - An object with the end line / column of the selection
*/
getSelectionCursor() {
const cm = editors.get(this);
if (this.config.cm6) {
const selection = cm.state.selection.ranges[0];
const lineFrom = cm.state.doc.lineAt(selection.from);
const lineTo = cm.state.doc.lineAt(selection.to);
return {
from: {
line: lineFrom.number,
ch: selection.from - lineFrom.from,
},
to: {
line: lineTo.number,
ch: selection.to - lineTo.from,
},
};
}
return {
from: cm.getCursor("from"),
to: cm.getCursor("to"),
};
}
/**
* Gets the text content for the current selection
* @returns {String}
*/
getSelectedText() {
const cm = editors.get(this);
if (this.config.cm6) {
const selection = cm.state.selection.ranges[0];
return cm.state.doc.sliceString(selection.from, selection.to);
}
return cm.getSelection().trim();
}
/**
* Given screen coordinates this should return the line and column
* related. This used currently to determine the line and columns
* for the tokens that are hovered over.
* @param {Number} left - Horizontal position from the left
* @param {Number} top - Vertical position from the top
* @returns {Object} position - The line and column related to the screen coordinates.
*/
getPositionAtScreenCoords(left, top) {
const cm = editors.get(this);
if (this.config.cm6) {
const position = cm.posAtCoords(
{ x: left, y: top },
// "precise", i.e. if a specific position cannot be determined, an estimated one will be used
false
);
const line = cm.state.doc.lineAt(position);
return {
line: line.number,
column: position - line.from,
};
}
const { line, ch } = cm.coordsChar(
{ left, top },
// Use the "window" context where the coordinates are relative to the top-left corner
// of the currently visible (scrolled) window.
// This enables codemirror also correctly handle wrappped lines in the editor.
"window"
);
return {
line: line + 1,
column: ch,
};
}
/**
* Check that text is selected
* @returns {Boolean}
*/
isTextSelected() {
const cm = editors.get(this);
if (this.config.cm6) {
const selection = cm.state.selection.ranges[0];
return selection.from !== selection.to;
}
return cm.somethingSelected();
}
/**
* Returns a boolean indicating whether the editor is ready to
* use. Use appendTo(el).then(() => {}) for most cases
*/
isAppended() {
return editors.has(this);
}
/**
* Returns the currently active highlighting mode.
* See Editor.modes for the list of all suppoert modes.
*/
getMode() {
return this.getOption("mode");
}
/**
* Loads a script into editor's containing window.
*/
loadScript(url) {
if (!this.container) {
throw new Error("Can't load a script until the editor is loaded.");
}
const win = this.container.contentWindow.wrappedJSObject;
Services.scriptloader.loadSubScript(url, win);
}
/**
* Creates a CodeMirror Document
*
* @param {String} text: Initial text of the document
* @param {Object|String} mode: Mode of the document. See https://codemirror.net/5/doc/manual.html#option_mode
* @returns CodeMirror.Doc
*/
createDocument(text = "", mode) {
return new this.Doc(text, mode);
}
/**
* Replaces the current document with a new source document
*/
replaceDocument(doc) {
const cm = editors.get(this);
cm.swapDoc(doc);
}
/**
* Changes the value of a currently used highlighting mode.
* See Editor.modes for the list of all supported modes.
*/
setMode(value) {
if (this.config.cm6) {
const cm = editors.get(this);
return cm.dispatch({
effects: this.#compartments.languageCompartment.reconfigure([
this.#languageModes.get(value),
]),
});
}
this.setOption("mode", value);
// If autocomplete was set up and the mode is changing, then
// turn it off and back on again so the proper mode can be used.
if (this.config.autocomplete) {
this.setOption("autocomplete", false);
this.setOption("autocomplete", true);
}
return null;
}
/**
* The source editor can expose several commands linked from system and context menus.
* Kept for backward compatibility with styleeditor.
*/
insertCommandsController() {
const {
insertCommandsController,
} = require("resource://devtools/client/shared/sourceeditor/editor-commands-controller.js");
insertCommandsController(this);
}
/**
* Returns text from the text area. If line argument is provided
* the method returns only that line.
*/
getText(line) {
const cm = editors.get(this);
if (line == null) {
return this.config.cm6 ? cm.state.doc.toString() : cm.getValue();
}
const info = this.lineInfo(line);
return info ? info.text : "";
}
getDoc() {
if (!this.config) {
return null;
}
const cm = editors.get(this);
if (this.config.cm6) {
if (!this.#currentDocument) {
// A key for caching the WASM content in the WeakMap
this.#currentDocument = { id: this.#currentDocumentId };
}
return this.#currentDocument;
}
return cm.getDoc();
}
get isWasm() {
return wasm.isWasm(this.getDoc());
}
getWasmLineNumberFormatter() {
return wasm.getWasmLineNumberFormatter(this.getDoc());
}
wasmOffsetToLine(offset) {
return wasm.wasmOffsetToLine(this.getDoc(), offset);
}
lineToWasmOffset(number) {
return wasm.lineToWasmOffset(this.getDoc(), number);
}
toLineIfWasmOffset(maybeOffset) {
if (typeof maybeOffset !== "number" || !this.isWasm) {
return maybeOffset;
}
return this.wasmOffsetToLine(maybeOffset);
}
renderWasmText(content) {
return wasm.renderWasmText(this.getDoc(), content);
}
/**
* Gets details about the line
*
* @param {Number} line
* @returns {Object} line info object
*/
lineInfo(line) {
const cm = editors.get(this);
if (this.config.cm6) {
const el = this.getElementAtLine(line);
return {
text: el.innerText,
// TODO: Expose those, or see usage for those and do things differently
line: null,
gutterMarkers: null,
textClass: null,
bgClass: null,
wrapClass: el.className,
widgets: null,
};
}
return cm.lineInfo(line);
}
/**
* Get the functions symbols for the current source loaded in the
* the editor.
*
* @param {Number} maxResults - The maximum no of results to display
*/
async getFunctionSymbols(maxResults) {
const cm = editors.get(this);
const { codemirrorLanguage } = this.#CodeMirror6;
const functionSymbols = [];
let resultsCount = 0;
await lezerUtils.walkTree(cm, codemirrorLanguage, {
filterSet: lezerUtils.nodeTypeSets.functionsDeclAndExpr,
enterVisitor: node => {
if (resultsCount == maxResults) {
return;
}
const syntaxNode = node.node;
const name = lezerUtils.getFunctionName(cm.state.doc, syntaxNode);
// Ignore anonymous functions
if (name == null) {
return;
}
functionSymbols.push({
name,
klass: lezerUtils.getFunctionClass(cm.state.doc, syntaxNode),
location: {
start: lezerUtils.positionToLocation(cm.state.doc, node.from),
end: lezerUtils.positionToLocation(cm.state.doc, node.to),
},
parameterNames: lezerUtils.getFunctionParameterNames(
cm.state.doc,
syntaxNode
),
identifier: null,
index: node.index,
});
resultsCount++;
},
forceParseTo: cm.state.doc.length,
});
return functionSymbols;
}
/**
* Get the class symbols for the current source loaded in the the editor.
*
* @returns
*/
async getClassSymbols() {
const cm = editors.get(this);
const { codemirrorLanguage } = this.#CodeMirror6;
const classSymbols = [];
await lezerUtils.walkTree(cm, codemirrorLanguage, {
filterSet: lezerUtils.nodeTypeSets.classes,
enterVisitor: node => {
const classVarDefNode = node.node.firstChild.nextSibling;
classSymbols.push({
name: cm.state.doc.sliceString(
classVarDefNode.from,
classVarDefNode.to
),
location: {
start: lezerUtils.positionToLocation(cm.state.doc, node.from),
end: lezerUtils.positionToLocation(cm.state.doc, node.to),
},
});
},
forceParseTo: cm.state.doc.length,
});
return classSymbols;
}
/**
* Finds the best function name for the location specified.
* This is used to map original function names to their corresponding
* generated functions.
*
* @param {Object} location
* @returns
*/
async getClosestFunctionName(location) {
const cm = editors.get(this);
const {
codemirrorLangJavascript: { javascriptLanguage },
codemirrorLanguage: { forceParsing, syntaxTree },
} = this.#CodeMirror6;
let doc, tree;
// If the specified source is already loaded in the editor,
// codemirror has likely parsed most or all the source needed,
// just leverage that
const sourceId = location.source.id;
if (this.#currentDocumentId === sourceId) {
doc = cm.state.doc;
// Parse the rest of the if needed.
await forceParsing(cm, doc.length, 10000);
tree = syntaxTree(cm.state);
} else {
// If the source is not currently loaded in the editor we will need
// to explicitly parse its source text.
// Note: The `loadSourceText` actions is called before this util `getClosestFunctionName`
// to make sure source content is available to use.
const sourceContent = this.#sources.get(location.source.id);
if (!sourceContent) {
console.error(
`Can't find source content for ${location.source.id}, no function name can be determined`
);
return "";
}
// Create a codemirror document for the current source text.
doc = cm.state.toText(sourceContent);
tree = lezerUtils.getTree(javascriptLanguage, sourceId, sourceContent);
}
const token = lezerUtils.getTreeNodeAtLocation(doc, tree, location);
if (!token) {
return null;
}
const enclosingScope = lezerUtils.getEnclosingFunction(doc, token);
return enclosingScope ? enclosingScope.funcName : "";
}
/**
* Traverse the syntaxTree and return expressions
* which best match the specified token location is on our
* list of accepted symbol types.
*
* @param {Object} tokenLocation
* @returns {Array} Member expression matches
*/
async findBestMatchExpressions(tokenLocation) {
const cm = editors.get(this);
const { codemirrorLanguage } = this.#CodeMirror6;
const expressions = [];
const line = cm.state.doc.line(tokenLocation.line);
const tokPos = line.from + tokenLocation.column;
await lezerUtils.walkTree(cm, codemirrorLanguage, {
filterSet: lezerUtils.nodeTypeSets.expressions,
enterVisitor: node => {
if (node.from <= tokPos && node.to >= tokPos) {
expressions.push({
type: node.name,
// Computed member expressions not currently supported
computed: false,
expression: cm.state.doc.sliceString(node.from, node.to),
location: {
start: lezerUtils.positionToLocation(cm.state.doc, node.from),
end: lezerUtils.positionToLocation(cm.state.doc, node.to),
},
from: node.from,
to: node.to,
});
}
},
walkFrom: line.from,
walkTo: line.to,
});
// There might be multiple expressions which are within the locations.
// We want to match expressions based on dots before the desired token.
//
// ========================== EXAMPLE 1 ================================
// Full Expression: `this.myProperty.x`
// Hovered Token: `myProperty`
// Found Expressions:
// { name: "MemberExpression", expression: "this.myProperty.x", from: 1715, to: 1732 }
// { name: "MemberExpression", expression: "this.myProperty" from: 1715, to: 1730 } *
// { name: "PropertyName", expression: "myProperty" from: 1720, to: 1730 }
//
// ========================== EXAMPLE 2 ==================================
// Full Expression: `a(b).catch`
// Hovered Token: `b`
// Found Expressions:
// { name: "MemberExpression", expression: "a(b).catch", from: 1921 to: 1931 }
// { name: "VariableName", expression: "b", from: 1923 to: 1924 } *
//
// We sort based on the `to` make sure we return the correct property
return expressions.sort((a, b) => {
if (a.to < b.to) {
return -1;
} else if (a.to > b.to) {
return 1;
}
return 0;
});
}
/**
* Get all the lines which are inscope when paused a the specified location.
*
* @param {Object} location
* @param {Array} in scope lines
*/
async getInScopeLines(location) {
const cm = editors.get(this);
const { codemirrorLanguage } = this.#CodeMirror6;
const functionLocations = [];
await lezerUtils.walkTree(cm, codemirrorLanguage, {
filterSet: lezerUtils.nodeTypeSets.functions,
enterVisitor: node => {
functionLocations.push({
name: node.name,
start: lezerUtils.positionToLocation(cm.state.doc, node.from),
end: lezerUtils.positionToLocation(cm.state.doc, node.to),
});
},
forceParseTo: cm.viewport.to,
});
// Sort based on the start locations so the scopes
// are in the same order as in the source.
const sortedLocations = scopeUtils.sortByStart(functionLocations);
// Any function locations which are within the immediate function scope
// of the paused location.
const innerLocations = scopeUtils.getInnerLocations(
sortedLocations,
location
);
// Any outer locations which do not contain the immediate function
// of the paused location
const outerLocations = sortedLocations.filter(loc => {
if (innerLocations.includes(loc)) {
return false;
}
return !scopeUtils.containsPosition(loc, location);
});
const outOfScopeLines = scopeUtils.getOutOfScopeLines(
scopeUtils.removeOverlapLocations(outerLocations)
);
// This operation can be very costly for large files so we sacrifice a bit of readability
// for performance sake.
// We initialize an array with a fixed size and we'll directly assign value for lines
// that are not out of scope. This is much faster than having an empty array and pushing
// into it.
const sourceNumLines = cm.state.doc.lines;
const sourceLines = new Array(sourceNumLines);
for (let i = 0; i < sourceNumLines; i++) {
const line = i + 1;
if (outOfScopeLines.size == 0 || !outOfScopeLines.has(line)) {
sourceLines[i] = line;
}
}
// Finally we need to remove any undefined values, i.e. the ones that were matching
// out of scope lines.
return sourceLines.filter(i => i != undefined);
}
/**
* Gets all the bindings and generates the related references for
* the specified platform scope and its ancestry
*
* @param {Object} location - The currently paused location
* @param {Object} scope - The innermost scope node for the tree. This is provided by the
* platform.
* @returns {Object} Binding references
* Structure
* ==========
* {
* 0: { // Levels
* a: { // Binding
* enumerable: true,
* configurable: false
* value: "foo"
* refs: [{ // References
* start: { line: 1, column: 4 }
* end: { line: 3, column: 5 }
* }]
* },
* ...
* }
**/
async getBindingReferences(location, scope) {
const cm = editors.get(this);
const {
codemirrorLanguage: { syntaxTree },
} = this.#CodeMirror6;
const token = lezerUtils.getTreeNodeAtLocation(
cm.state.doc,
syntaxTree(cm.state),
location
);
if (!token) {
return null;
}
let scopeNode = null;
let level = 0;
const bindingReferences = {};
// Walk up the scope tree and generate the bindings and references
while (scope && scope.bindings) {
const bindings = lezerUtils.getScopeBindings(scope.bindings);
const seen = new Set();
scopeNode = lezerUtils.getParentScopeOfType(
scopeNode || token,
scope.type
);
if (!scopeNode) {
break;
}
await lezerUtils.walkCursor(scopeNode.node.cursor(), {
filterSet: lezerUtils.nodeTypeSets.bindingReferences,
enterVisitor: node => {
let bindingName = cm.state.doc.sliceString(node.from, node.to);
if (!(bindingName in bindings) || seen.has(bindingName)) {
return;
}
const bindingData = bindings[bindingName];
const ref = {
start: lezerUtils.positionToLocation(cm.state.doc, node.from),
end: lezerUtils.positionToLocation(cm.state.doc, node.to),
};
const syntaxNode = node.node;
// Previews for member expressions are built of the meta property which is
// reference of the child property and so on. e.g a.b.c
if (syntaxNode.parent.name == lezerUtils.nodeTypes.MemberExpression) {
ref.meta = lezerUtils.getMetaBindings(
cm.state.doc,
syntaxNode.parent
);
// For member expressions use the name of the parent object as the binding name
// i.e for `obj.a.b` the binding name should be `obj`
bindingName = cm.state.doc.sliceString(
syntaxNode.parent.from,
syntaxNode.parent.to
);
const dotIndex = bindingName.indexOf(".");
if (dotIndex > -1) {
bindingName = bindingName.substring(0, dotIndex);
}
}
if (!bindingReferences[level]) {
bindingReferences[level] = Object.create(null);
}
if (!bindingReferences[level][bindingName]) {
// Put the binding info and related references together for
// easy and efficient access.
bindingReferences[level][bindingName] = {
...bindingData,
refs: [],
};
}
bindingReferences[level][bindingName].refs.push(ref);
seen.add(bindingName);
},
});
if (scope.type === "function") {
break;
}
level++;
scope = scope.parent;
}
return bindingReferences;
}
/**
* Replaces whatever is in the text area with the contents of
* the 'value' argument.
*
* @param {String} value: The text to replace the editor content
* @param {String} documentId: Optional unique id represeting the specific document which is source of the text.
* Will be null for loading and error messages.
*/
async setText(value, documentId) {
const cm = editors.get(this);
const isWasm = typeof value !== "string" && "binary" in value;
if (documentId) {
this.#currentDocumentId = documentId;
} else {
// Reset this ID when showing loading and error messages,
// so that we keep track when an actual source is displayed
this.#currentDocumentId = null;
}
if (isWasm) {
// wasm?
// binary does not survive as Uint8Array, converting from string
const binary = value.binary;
const data = new Uint8Array(binary.length);
for (let i = 0; i < data.length; i++) {
data[i] = binary.charCodeAt(i);
}
const { lines, done } = wasm.getWasmText(this.getDoc(), data);
const MAX_LINES = 10000000;
if (lines.length > MAX_LINES) {
lines.splice(MAX_LINES, lines.length - MAX_LINES);
lines.push(";; .... text is truncated due to the size");
}
if (!done) {
lines.push(";; .... possible error during wast conversion");
}
if (this.config.cm6) {
value = lines.join("\n");
} else {
// cm will try to split into lines anyway, saving memory
value = { split: () => lines };
}
}
if (this.config.cm6) {
if (cm.state.doc.toString() == value) {
return;
}
const {
codemirrorView: { EditorView, lineNumbers },
} = this.#CodeMirror6;
await cm.dispatch({
changes: { from: 0, to: cm.state.doc.length, insert: value },
selection: { anchor: 0 },
});
const effects = [];
if (this.config?.lineNumbers) {
const lineNumbersConfig = {
domEventHandlers: this.#gutterDOMEventHandlers,
};
if (isWasm) {
lineNumbersConfig.formatNumber = this.getWasmLineNumberFormatter();
}
effects.push(
this.#compartments.lineNumberCompartment.reconfigure(
lineNumbers(lineNumbersConfig)
)
);
}
// Get the cached scroll snapshot for this source and restore
// the scroll position. Note: The scroll has to be done in a seperate dispatch
// (after the previous dispatch has set the document), this is because
// it is required that the document the scroll snapshot is applied to
// is the exact document it was saved on.
const scrollSnapshot = this.#scrollSnapshots.get(documentId);
effects.push(
scrollSnapshot ? scrollSnapshot : EditorView.scrollIntoView(0)
);
await cm.dispatch({ effects });
if (this.currentDocumentId) {
// If there is no scroll snapshot explicitly cache the snapshot set as no scroll
// is triggered.
if (!scrollSnapshot) {
this.#cacheScrollSnapshot();
}
}
} else {
cm.setValue(value);
}
this.resetIndentUnit();
}
addSource(id, sourceText) {
this.#sources.set(id, sourceText);
}
clearSources(ids) {
if (ids) {
for (const id of ids) {
this.#sources.delete(id);
}
} else {
this.#sources.clear();
lezerUtils.clear();
}
}
/* Currently used only in tests */
sourcesCount() {
return this.#sources.size;
}
/**
* Reloads the state of the editor based on all current preferences.
* This is called automatically when any of the relevant preferences
* change.
*/
reloadPreferences() {
// Restore the saved autoCloseBrackets value if it is preffed on.
const useAutoClose = Services.prefs.getBoolPref(AUTO_CLOSE);
this.setOption(
"autoCloseBrackets",
useAutoClose ? this.config.autoCloseBracketsSaved : false
);
this.updateCodeFoldingGutter();
this.resetIndentUnit();
this.setupAutoCompletion();
}
/**
* Set the current keyMap for CodeMirror, and load the support file if needed.
*
* @param {Window} win: The window on which the keymap files should be loaded.
*/
setKeyMap(win) {
if (this.config.isReadOnly) {
return;
}
const keyMap = Services.prefs.getCharPref(KEYMAP_PREF);
// If alternative keymap is provided, use it.
if (VALID_KEYMAPS.has(keyMap)) {
if (!this.#loadedKeyMaps.has(keyMap)) {
Services.scriptloader.loadSubScript(VALID_KEYMAPS.get(keyMap), win);
this.#loadedKeyMaps.add(keyMap);
}
this.setOption("keyMap", keyMap);
} else {
this.setOption("keyMap", "default");
}
}
/**
* Sets the editor's indentation based on the current prefs and
* re-detect indentation if we should.
*/
resetIndentUnit() {
if (this.isDestroyed()) {
return;
}
const cm = editors.get(this);
const iterFn = (start, maxEnd, callback) => {
if (!this.config.cm6) {
if (this.isDestroyed()) {
return;
}
cm.eachLine(start, maxEnd, line => {
return callback(line.text);
});
} else {
const iterator = cm.state.doc.iterLines(
start + 1,
Math.min(cm.state.doc.lines, maxEnd) + 1
);
let callbackRes;
do {
iterator.next();
callbackRes = callback(iterator.value);
} while (iterator.done !== true && !callbackRes);
}
};
const { indentUnit, indentWithTabs } = getIndentationFromIteration(iterFn);
if (!this.config.cm6) {
cm.setOption("tabSize", indentUnit);
cm.setOption("indentUnit", indentUnit);
cm.setOption("indentWithTabs", indentWithTabs);
} else {
const {
codemirrorState: { EditorState },
codemirrorLanguage,
} = this.#CodeMirror6;
cm.dispatch({
effects: this.#compartments.tabSizeCompartment.reconfigure(
EditorState.tabSize.of(indentUnit)
),
});
cm.dispatch({
effects: this.#compartments.indentCompartment.reconfigure(
codemirrorLanguage.indentUnit.of(
(indentWithTabs ? "\t" : " ").repeat(indentUnit)
)
),
});
}
}
/**
* Replaces contents of a text area within the from/to {line, ch}
* range. If neither `from` nor `to` arguments are provided works
* exactly like setText. If only `from` object is provided, inserts
* text at that point, *overwriting* as many characters as needed.
*/
replaceText(value, from, to) {
const cm = editors.get(this);
if (!from) {
this.setText(value);
return;
}
if (!to) {
const text = cm.getRange({ line: 0, ch: 0 }, from);
this.setText(text + value);
return;
}
cm.replaceRange(value, from, to);
}
/**
* Inserts text at the specified {line, ch} position, shifting existing
* contents as necessary.
*/
insertText(value, at) {
const cm = editors.get(this);
cm.replaceRange(value, at, at);
}
/**
* Deselects contents of the text area.
*/
dropSelection() {
if (!this.somethingSelected()) {
return;
}
this.setCursor(this.getCursor());
}
/**
* Returns true if there is more than one selection in the editor.
*/
hasMultipleSelections() {
const cm = editors.get(this);
return cm.listSelections().length > 1;
}
/**
* Gets the first visible line number in the editor.
*/
getFirstVisibleLine() {
const cm = editors.get(this);
return cm.lineAtHeight(0, "local");
}
/**
* Scrolls the view such that the given line number is the first visible line.
*/
setFirstVisibleLine(line) {
const cm = editors.get(this);
const { top } = cm.charCoords({ line, ch: 0 }, "local");
cm.scrollTo(0, top);
}
/**
* Sets the cursor to the specified {line, ch} position with an additional
* option to align the line at the "top", "center" or "bottom" of the editor
* with "top" being default value.
*/
setCursor({ line, ch }, align) {
const cm = editors.get(this);
this.alignLine(line, align);
cm.setCursor({ line, ch });
this.emit("cursorActivity");
}
/**
* Aligns the provided line to either "top", "center" or "bottom" of the
* editor view with a maximum margin of MAX_VERTICAL_OFFSET lines from top or
* bottom.
*/
alignLine(line, align) {
const cm = editors.get(this);
const from = cm.lineAtHeight(0, "page");
const to = cm.lineAtHeight(cm.getWrapperElement().clientHeight, "page");
const linesVisible = to - from;
const halfVisible = Math.round(linesVisible / 2);
// If the target line is in view, skip the vertical alignment part.
if (line <= to && line >= from) {
return;
}
// Setting the offset so that the line always falls in the upper half
// of visible lines (lower half for bottom aligned).
// MAX_VERTICAL_OFFSET is the maximum allowed value.
const offset = Math.min(halfVisible, MAX_VERTICAL_OFFSET);
let topLine =
{
center: Math.max(line - halfVisible, 0),
bottom: Math.max(line - linesVisible + offset, 0),
top: Math.max(line - offset, 0),
}[align || "top"] || offset;
// Bringing down the topLine to total lines in the editor if exceeding.
topLine = Math.min(topLine, this.lineCount());
this.setFirstVisibleLine(topLine);
}
/**
* Returns whether a marker of a specified class exists in a line's gutter.
*/
hasMarker(line, gutterName, markerClass) {
const marker = this.getMarker(line, gutterName);
if (!marker) {
return false;
}
return marker.classList.contains(markerClass);
}
/**
* Adds a marker with a specified class to a line's gutter. If another marker
* exists on that line, the new marker class is added to its class list.
*/
addMarker(line, gutterName, markerClass) {
const cm = editors.get(this);
const info = this.lineInfo(line);
if (!info) {
return;
}
const gutterMarkers = info.gutterMarkers;
let marker;
if (gutterMarkers) {
marker = gutterMarkers[gutterName];
if (marker) {
marker.classList.add(markerClass);
return;
}
}
marker = cm.getWrapperElement().ownerDocument.createElement("div");
marker.className = markerClass;
cm.setGutterMarker(info.line, gutterName, marker);
}
/**
* The reverse of addMarker. Removes a marker of a specified class from a
* line's gutter.
*/
removeMarker(line, gutterName, markerClass) {
if (!this.hasMarker(line, gutterName, markerClass)) {
return;
}
this.lineInfo(line).gutterMarkers[gutterName].classList.remove(markerClass);
}
/**
* Adds a marker with a specified class and an HTML content to a line's
* gutter. If another marker exists on that line, it is overwritten by a new
* marker.
*/
addContentMarker(line, gutterName, markerClass, content) {
const cm = editors.get(this);
const info = this.lineInfo(line);
if (!info) {
return;
}
const marker = cm.getWrapperElement().ownerDocument.createElement("div");
marker.className = markerClass;
// eslint-disable-next-line no-unsanitized/property
marker.innerHTML = content;
cm.setGutterMarker(info.line, gutterName, marker);
}
/**
* The reverse of addContentMarker. Removes any line's markers in the
* specified gutter.
*/
removeContentMarker(line, gutterName) {
const cm = editors.get(this);
const info = this.lineInfo(line);
if (!info) {
return;
}
cm.setGutterMarker(info.line, gutterName, null);
}
getMarker(line, gutterName) {
const info = this.lineInfo(line);
if (!info) {
return null;
}
const gutterMarkers = info.gutterMarkers;
if (!gutterMarkers) {
return null;
}
return gutterMarkers[gutterName];
}
/**
* Removes all gutter markers in the gutter with the given name.
*/
removeAllMarkers(gutterName) {
const cm = editors.get(this);
cm.clearGutter(gutterName);
}
/**
* Handles attaching a set of events listeners on a marker. They should
* be passed as an object literal with keys as event names and values as
* function listeners. The line number, marker node and optional data
* will be passed as arguments to the function listener.
*
* You don't need to worry about removing these event listeners.
* They're automatically orphaned when clearing markers.
*/
setMarkerListeners(line, gutterName, markerClass, eventsArg, data) {
if (!this.hasMarker(line, gutterName, markerClass)) {
return;
}
const cm = editors.get(this);
const marker = cm.lineInfo(line).gutterMarkers[gutterName];
for (const name in eventsArg) {
const listener = eventsArg[name].bind(this, line, marker, data);
marker.addEventListener(name, listener, {
signal: this.#abortController?.signal,
});
}
}
/**
* Returns whether a line is decorated using the specified class name.
*/
hasLineClass(line, className) {
const info = this.lineInfo(line);
if (!info || !info.wrapClass) {
return false;
}
return info.wrapClass.split(" ").includes(className);
}
/**
* Sets a CSS class name for the given line, including the text and gutter.
*/
addLineClass(lineOrOffset, className) {
const cm = editors.get(this);
const line = this.toLineIfWasmOffset(lineOrOffset);
cm.addLineClass(line, "wrap", className);
}
/**
* The reverse of addLineClass.
*/
removeLineClass(lineOrOffset, className) {
const cm = editors.get(this);
const line = this.toLineIfWasmOffset(lineOrOffset);
cm.removeLineClass(line, "wrap", className);
}
/**
* Mark a range of text inside the two {line, ch} bounds. Since the range may
* be modified, for example, when typing text, this method returns a function
* that can be used to remove the mark.
*/
markText(from, to, className = "marked-text") {
const cm = editors.get(this);
const text = cm.getRange(from, to);
const span = cm.getWrapperElement().ownerDocument.createElement("span");
span.className = className;
span.textContent = text;
const mark = cm.markText(from, to, { replacedWith: span });
return {
anchor: span,
clear: () => mark.clear(),
};
}
/**
* Calculates and returns one or more {line, ch} objects for
* a zero-based index who's value is relative to the start of
* the editor's text.
*
* If only one argument is given, this method returns a single
* {line,ch} object. Otherwise it returns an array.
*/
getPosition(...args) {
const cm = editors.get(this);
const res = args.map(ind => cm.posFromIndex(ind));
return args.length === 1 ? res[0] : res;
}
/**
* The reverse of getPosition. Similarly to getPosition this
* method returns a single value if only one argument was given
* and an array otherwise.
*/
getOffset(...args) {
const cm = editors.get(this);
const res = args.map(pos => cm.indexFromPos(pos));
return args.length > 1 ? res : res[0];
}
/**
* Returns a {line, ch} object that corresponds to the
* left, top coordinates.
*/
getPositionFromCoords({ left, top }) {
const cm = editors.get(this);
return cm.coordsChar({ left, top });
}
/**
* Returns true if there's something to undo and false otherwise.
*/
canUndo() {
const cm = editors.get(this);
return cm.historySize().undo > 0;
}
/**
* Returns true if there's something to redo and false otherwise.
*/
canRedo() {
const cm = editors.get(this);
return cm.historySize().redo > 0;
}
/**
* Marks the contents as clean and returns the current
* version number.
*/
setClean() {
const cm = editors.get(this);
this.version = cm.changeGeneration();
this.#lastDirty = false;
this.emit("dirty-change");
return this.version;
}
/**
* Returns true if contents of the text area are
* clean i.e. no changes were made since the last version.
*/
isClean() {
const cm = editors.get(this);
return cm.isClean(this.version);
}
/**
* This method opens an in-editor dialog asking for a line to
* jump to. Once given, it changes cursor to that line.
*/
jumpToLine() {
const doc = editors.get(this).getWrapperElement().ownerDocument;
const div = doc.createElement("div");
const inp = doc.createElement("input");
const txt = doc.createTextNode(L10N.getStr("gotoLineCmd.promptTitle"));
inp.type = "text";
inp.style.width = "10em";
inp.style.marginInlineStart = "1em";
div.appendChild(txt);
div.appendChild(inp);
this.openDialog(div, line => {
// Handle LINE:COLUMN as well as LINE
const match = line.toString().match(RE_JUMP_TO_LINE);
if (match) {
const [, matchLine, column] = match;
this.setCursor({ line: matchLine - 1, ch: column ? column - 1 : 0 });
}
});
}
/**
* Moves the content of the current line or the lines selected up a line.
*/
moveLineUp() {
const cm = editors.get(this);
const start = cm.getCursor("start");
const end = cm.getCursor("end");
if (start.line === 0) {
return;
}
// Get the text in the lines selected or the current line of the cursor
// and append the text of the previous line.
let value;
if (start.line !== end.line) {
value =
cm.getRange(
{ line: start.line, ch: 0 },
{ line: end.line, ch: cm.getLine(end.line).length }
) + "\n";
} else {
value = cm.getLine(start.line) + "\n";
}
value += cm.getLine(start.line - 1);
// Replace the previous line and the currently selected lines with the new
// value and maintain the selection of the text.
cm.replaceRange(
value,
{ line: start.line - 1, ch: 0 },
{ line: end.line, ch: cm.getLine(end.line).length }
);
cm.setSelection(
{ line: start.line - 1, ch: start.ch },
{ line: end.line - 1, ch: end.ch }
);
}
/**
* Moves the content of the current line or the lines selected down a line.
*/
moveLineDown() {
const cm = editors.get(this);
const start = cm.getCursor("start");
const end = cm.getCursor("end");
if (end.line + 1 === cm.lineCount()) {
return;
}
// Get the text of next line and append the text in the lines selected
// or the current line of the cursor.
let value = cm.getLine(end.line + 1) + "\n";
if (start.line !== end.line) {
value += cm.getRange(
{ line: start.line, ch: 0 },
{ line: end.line, ch: cm.getLine(end.line).length }
);
} else {
value += cm.getLine(start.line);
}
// Replace the currently selected lines and the next line with the new
// value and maintain the selection of the text.
cm.replaceRange(
value,
{ line: start.line, ch: 0 },
{ line: end.line + 1, ch: cm.getLine(end.line + 1).length }
);
cm.setSelection(
{ line: start.line + 1, ch: start.ch },
{ line: end.line + 1, ch: end.ch }
);
}
/**
* Intercept CodeMirror's Find and replace key shortcut to select the search input
*/
findOrReplace(node, isReplaceAll) {
const cm = editors.get(this);
const isInput = node.tagName === "INPUT";
const isSearchInput = isInput && node.type === "search";
// replace box is a different input instance than search, and it is
// located in a code mirror dialog
const isDialogInput =
isInput &&
node.parentNode &&
node.parentNode.classList.contains("CodeMirror-dialog");
if (!(isSearchInput || isDialogInput)) {
return;
}
if (isSearchInput || isReplaceAll) {
// select the search input
// it's the precise reason why we reimplement these key shortcuts
node.select();
}
// need to call it since we prevent the propagation of the event and
// cancel codemirror's key handling
cm.execCommand("findPersistent");
}
/**
* Intercept CodeMirror's findNext and findPrev key shortcut to allow
* immediately search for next occurance after typing a word to search.
*/
findNextOrPrev(node, isFindPrev) {
const cm = editors.get(this);
const isInput = node.tagName === "INPUT";
const isSearchInput = isInput && node.type === "search";
if (!isSearchInput) {
return;
}
const query = node.value;
// cm.state.search allows to automatically start searching for the next occurance
// it's the precise reason why we reimplement these key shortcuts
if (!cm.state.search || cm.state.search.query !== query) {
cm.state.search = {
posFrom: null,
posTo: null,
overlay: null,
query,
};
}
// need to call it since we prevent the propagation of the event and
// cancel codemirror's key handling
if (isFindPrev) {
cm.execCommand("findPrev");
} else {
cm.execCommand("findNext");
}
}
/**
* Returns current font size for the editor area, in pixels.
*/
getFontSize() {
const cm = editors.get(this);
const el = cm.getWrapperElement();
const win = el.ownerDocument.defaultView;
return parseInt(win.getComputedStyle(el).getPropertyValue("font-size"), 10);
}
/**
* Sets font size for the editor area.
*/
setFontSize(size) {
const cm = editors.get(this);
cm.getWrapperElement().style.fontSize = parseInt(size, 10) + "px";
cm.refresh();
}
setLineWrapping(value) {
const cm = editors.get(this);
if (this.config.cm6) {
const {
codemirrorView: { EditorView },
} = this.#CodeMirror6;
cm.dispatch({
effects: this.#compartments.lineWrapCompartment.reconfigure(
value ? EditorView.lineWrapping : []
),
});
} else {
cm.setOption("lineWrapping", value);
}
this.config.lineWrapping = value;
}
/**
* Sets an option for the editor. For most options it just defers to
* CodeMirror.setOption, but certain ones are maintained within the editor
* instance.
*/
setOption(o, v) {
const cm = editors.get(this);
// Save the state of a valid autoCloseBrackets string, so we can reset
// it if it gets preffed off and back on.
if (o === "autoCloseBrackets" && v) {
this.config.autoCloseBracketsSaved = v;
}
if (o === "autocomplete") {
this.config.autocomplete = v;
this.setupAutoCompletion();
} else {
cm.setOption(o, v);
this.config[o] = v;
}
if (o === "enableCodeFolding") {
// The new value maybe explicitly force foldGUtter on or off, ignoring
// the prefs service.
this.updateCodeFoldingGutter();
}
}
/**
* Gets an option for the editor. For most options it just defers to
* CodeMirror.getOption, but certain ones are maintained within the editor
* instance.
*/
getOption(o) {
const cm = editors.get(this);
if (o === "autocomplete") {
return this.config.autocomplete;
}
return cm.getOption(o);
}
/**
* Sets up autocompletion for the editor. Lazily imports the required
* dependencies because they vary by editor mode.
*
* Autocompletion is special, because we don't want to automatically use
* it just because it is preffed on (it still needs to be requested by the
* editor), but we do want to always disable it if it is preffed off.
*/
setupAutoCompletion() {
if (!this.config.autocomplete && !this.initializeAutoCompletion) {
// Do nothing since there is no autocomplete config and no autocompletion have
// been initialized.
return;
}
// The autocomplete module will overwrite this.initializeAutoCompletion
// with a mode specific autocompletion handler.
if (!this.initializeAutoCompletion) {
this.extend(
require("resource://devtools/client/shared/sourceeditor/autocomplete.js")
);
}
if (this.config.autocomplete && Services.prefs.getBoolPref(AUTOCOMPLETE)) {
this.initializeAutoCompletion(this.config.autocompleteOpts);
} else {
this.destroyAutoCompletion();
}
}
getAutoCompletionText() {
const cm = editors.get(this);
const mark = cm
.getAllMarks()
.find(m => m.className === AUTOCOMPLETE_MARK_CLASSNAME);
if (!mark) {
return "";
}
return mark.attributes["data-completion"] || "";
}
setAutoCompletionText(text) {
const cursor = this.getCursor();
const cm = editors.get(this);
const className = AUTOCOMPLETE_MARK_CLASSNAME;
cm.operation(() => {
cm.getAllMarks().forEach(mark => {
if (mark.className === className) {
mark.clear();
}
});
if (text) {
cm.markText({ ...cursor, ch: cursor.ch - 1 }, cursor, {
className,
attributes: {
"data-completion": text,
},
});
}
});
}
/**
* Gets the element at the specified codemirror offset
* @param {Number} offset
* @return {Element|null}
*/
#getElementAtOffset(offset) {
const cm = editors.get(this);
const el = cm.domAtPos(offset).node;
if (!el) {
return null;
}
// Text nodes do not have offset* properties, so lets use its
// parent element;
if (el.nodeType == nodeConstants.TEXT_NODE) {
return el.parentElement;
}
return el;
}
/**
* This checks if the specified position (line/column) is within the current viewport
* bounds. it helps determine if scrolling should happen.
* @param {Number} line - The line in the source
* @param {Number} column - The column in the source
* @returns {Boolean}
*/
isPositionVisible(line, column) {
const cm = editors.get(this);
let inXView, inYView;
function withinBounds(x, min, max) {
return x >= min && x <= max;
}
if (this.config.cm6) {
const pos = this.#positionToOffset(line, column);
if (pos == null) {
return false;
}
// `coordsAtPos` returns the absolute position of the line/column location
// so that we have to ensure comparing with same absolute position for
// CodeMirror DOM Element.
//
// Note that it may return the coordinates for a column breakpoint marker
// so it may still report as visible, if the marker is on the edge of the viewport
// and the displayed character at line/column is actually hidden after the scrollable area.
const coords = cm.coordsAtPos(pos);
if (!coords) {
return false;
}
const { x, y, width, height } = cm.dom.getBoundingClientRect();
const gutterWidth = cm.dom.querySelector(".cm-gutters").clientWidth;
inXView = coords.left > x + gutterWidth && coords.right < x + width;
inYView = coords.top > y && coords.bottom < y + height;
} else {
const { top, left } = cm.charCoords({ line, ch: column }, "local");
const scrollArea = cm.getScrollInfo();
const charWidth = cm.defaultCharWidth();
const fontHeight = cm.defaultTextHeight();
const { scrollTop, scrollLeft } = cm.doc;
inXView = withinBounds(
left,
scrollLeft,
// Note: 30 might relate to the margin on one of the scroll bar elements.
scrollLeft + (scrollArea.clientWidth - 30) - charWidth
);
inYView = withinBounds(
top,
scrollTop,
scrollTop + scrollArea.clientHeight - fontHeight
);
}
return inXView && inYView;
}
/**
* Converts line/col to CM6 offset position
* @param {Number} line - The line in the source
* @param {Number} col - The column in the source
* @returns {Number}
*/
#positionToOffset(line, col = 0) {
const cm = editors.get(this);
try {
const offset = cm.state.doc.line(line);
return offset.from + col;
} catch (e) {
// Line likey does not exist in viewport yet
console.warn(e.message);
}
return null;
}
/**
* This returns the line and column for the specified search cursor's position
*
* @param {RegExpSearchCursor} searchCursor
* @returns {Object}
*/
getPositionFromSearchCursor(searchCursor) {
const cm = editors.get(this);
const lineFrom = cm.state.doc.lineAt(searchCursor.from);
return {
line: lineFrom.number - 1,
ch: searchCursor.to - searchCursor.match[0].length - lineFrom.from,
};
}
/**
* Scrolls the editor to the specified codemirror position
*
* @param {Number} position
*/
scrollToPosition(position) {
const cm = editors.get(this);
if (!this.config.cm6) {
throw new Error("This function is only compatible with CM6");
}
const {
codemirrorView: { EditorView },
} = this.#CodeMirror6;
return cm.dispatch({
effects: EditorView.scrollIntoView(position, {
x: "nearest",
y: "center",
}),
});
}
/**
* Scrolls the editor to the specified line and column
* @param {Number} line - The line in the source
* @param {Number} column - The column in the source
* @param {String|null} yAlign - Optional value for position of the line after the line is scrolled.
* (Used by `scrollEditorIntoView` test helper)
*/
async scrollTo(line, column, yAlign) {
if (this.isDestroyed()) {
return null;
}
const cm = editors.get(this);
if (this.config.cm6) {
const {
codemirrorView: { EditorView },
} = this.#CodeMirror6;
if (!this.isPositionVisible(line, column)) {
const offset = this.#positionToOffset(line, column);
if (offset == null) {
return null;
}
return cm.dispatch({
effects: EditorView.scrollIntoView(offset, {
x: "center",
y: yAlign || "center",
}),
});
}
} else {
// For all cases where these are on the first line and column,
// avoid the possibly slow computation of cursor location on large bundles.
if (!line && !column) {
cm.scrollTo(0, 0);
return null;
}
const { top, left } = cm.charCoords({ line, ch: column }, "local");
if (!this.isPositionVisible(line, column)) {
const scroller = cm.getScrollerElement();
const centeredX = Math.max(left - scroller.offsetWidth / 2, 0);
const centeredY = Math.max(top - scroller.offsetHeight / 2, 0);
return cm.scrollTo(centeredX, centeredY);
}
}
return null;
}
// Used only in tests
setSelectionAt(start, end) {
const cm = editors.get(this);
if (this.config.cm6) {
const from = this.#positionToOffset(start.line, start.column);
const to = this.#positionToOffset(end.line, end.column);
if (from == null || to == null) {
return;
}
cm.dispatch({ selection: { anchor: from, head: to } });
} else {
cm.setSelection(
{ line: start.line - 1, ch: start.column },
{ line: end.line - 1, ch: end.column }
);
}
}
/**
* Move CodeMirror cursor to a given location.
*
* @param {Number} line
* @param {Number} column
*/
setCursorAt(line, column) {
const cm = editors.get(this);
if (this.config.cm6) {
const { lines } = cm.state.doc;
if (line > lines) {
console.error(
`Trying to set the cursor on a non-existing line ${line} > ${lines}`
);
return null;
}
const lineInfo = cm.state.doc.line(line + 1);
if (column >= lineInfo.length) {
console.error(
`Trying to set the cursor on a non-existing column ${column} >= ${lineInfo.length}`
);
return null;
}
const position = lineInfo.from + column;
return cm.dispatch({ selection: { anchor: position, head: position } });
}
return cm.setCursor({ line, ch: column });
}
// Used only in tests
getEditorFileMode() {
const cm = editors.get(this);
if (this.config.cm6) {
return cm.contentDOM.dataset.language;
}
return cm.getOption("mode").name;
}
// Used only in tests
getEditorContent() {
const cm = editors.get(this);
if (this.config.cm6) {
return cm.state.doc.toString();
}
return cm.getValue();
}
isSearchStateReady() {
const cm = editors.get(this);
if (this.config.cm6) {
return !!this.searchState.cursors;
}
return !!cm.state.search;
}
// Used only in tests
getCoords(line, column = 0) {
const cm = editors.get(this);
if (this.config.cm6) {
const offset = this.#positionToOffset(line, column);
if (offset == null) {
return null;
}
return cm.coordsAtPos(offset);
}
// CodeMirror is 0-based while line and column arguments are 1-based.
// Pass "column=-1" when there is no column argument passed.
return cm.charCoords({ line: ~~line, ch: ~~column });
}
// Used only in tests
// Only used for CM6
getElementAtLine(line) {
const offset = this.#positionToOffset(line);
const el = this.#getElementAtOffset(offset);
return el.closest(".cm-line");
}
// Used only in tests
getSearchQuery() {
const cm = editors.get(this);
if (this.config.cm6) {
return this.searchState.query.toString();
}
return cm.state.search.query;
}
// Used only in tests
// Gets currently selected search term
getSearchSelection() {
const cm = editors.get(this);
if (this.config.cm6) {
const cursor =
this.searchState.cursors[this.searchState.currentCursorIndex];
if (!cursor) {
return { text: "", line: -1, column: -1 };
}
const cursorPosition = lezerUtils.positionToLocation(
cm.state.doc,
cursor.to
);
// The lines in CM6 are 1 based
return {
text: cursor.match[0],
line: cursorPosition.line - 1,
column: cursorPosition.column,
};
}
const cursor = cm.getCursor();
return {
text: cm.getSelection(),
line: cursor.line,
column: cursor.ch,
};
}
// Only used for CM6
getElementAtPos(line, column) {
const offset = this.#positionToOffset(line, column);
const el = this.#getElementAtOffset(offset);
return el;
}
// Used only in tests
getLineCount() {
const cm = editors.get(this);
if (this.config.cm6) {
return cm.state.doc.lines;
}
return cm.lineCount();
}
/**
* Extends an instance of the Editor object with additional
* functions. Each function will be called with context as
* the first argument. Context is a {ed, cm} object where
* 'ed' is an instance of the Editor object and 'cm' is an
* instance of the CodeMirror object. Example:
*
* function hello(ctx, name) {
* let { cm, ed } = ctx;
* cm; // CodeMirror instance
* ed; // Editor instance
* name; // 'Mozilla'
* }
*
* editor.extend({ hello: hello });
* editor.hello('Mozilla');
*/
extend(funcs) {
Object.keys(funcs).forEach(name => {
const cm = editors.get(this);
const ctx = { ed: this, cm, Editor };
if (name === "initialize") {
funcs[name](ctx);
return;
}
this[name] = funcs[name].bind(null, ctx);
});
}
isDestroyed() {
return !this.config || !editors.get(this);
}
destroy() {
if (this.config.cm6 && this.#CodeMirror6) {
this.#clearEditorDOMEventListeners();
}
if (this.#abortController) {
this.#abortController.abort();
this.#abortController = null;
}
this.container = null;
this.config = null;
this.version = null;
this.#ownerDoc = null;
this.#updateListener = null;
this.#lineGutterMarkers.clear();
this.#lineContentMarkers.clear();
this.#scrollSnapshots.clear();
this.#languageModes.clear();
this.clearSources();
if (this.#prefObserver) {
this.#prefObserver.off(KEYMAP_PREF, this.setKeyMap);
this.#prefObserver.off(TAB_SIZE, this.reloadPreferences);
this.#prefObserver.off(EXPAND_TAB, this.reloadPreferences);
this.#prefObserver.off(AUTO_CLOSE, this.reloadPreferences);
this.#prefObserver.off(AUTOCOMPLETE, this.reloadPreferences);
this.#prefObserver.off(DETECT_INDENT, this.reloadPreferences);
this.#prefObserver.off(ENABLE_CODE_FOLDING, this.reloadPreferences);
this.#prefObserver.destroy();
}
// Remove the link between the document and code-mirror.
const cm = editors.get(this);
if (cm?.doc) {
cm.doc.cm = null;
}
// Destroy the CM6 view
if (cm?.destroy) {
cm.destroy();
}
this.emit("destroy");
}
updateCodeFoldingGutter() {
let shouldFoldGutter = this.config.enableCodeFolding;
const foldGutterIndex = this.config.gutters.indexOf(
"CodeMirror-foldgutter"
);
const cm = editors.get(this);
if (shouldFoldGutter === undefined) {
shouldFoldGutter = Services.prefs.getBoolPref(ENABLE_CODE_FOLDING);
}
if (shouldFoldGutter) {
// Add the gutter before enabling foldGutter
if (foldGutterIndex === -1) {
const gutters = this.config.gutters.slice();
gutters.push("CodeMirror-foldgutter");
this.setOption("gutters", gutters);
}
this.setOption("foldGutter", true);
} else {
// No code should remain folded when folding is off.
if (cm) {
cm.execCommand("unfoldAll");
}
// Remove the gutter so it doesn't take up space
if (foldGutterIndex !== -1) {
const gutters = this.config.gutters.slice();
gutters.splice(foldGutterIndex, 1);
this.setOption("gutters", gutters);
}
this.setOption("foldGutter", false);
}
}
/**
* Register all key shortcuts.
*/
#initSearchShortcuts(win) {
const shortcuts = new KeyShortcuts({
window: win,
});
const keys = ["find.key", "findNext.key", "findPrev.key"];
if (OS === "Darwin") {
keys.push("replaceAllMac.key");
} else {
keys.push("replaceAll.key");
}
// Process generic keys:
keys.forEach(name => {
const key = L10N.getStr(name);
shortcuts.on(key, event => this.#onSearchShortcut(name, event));
});
}
/**
* Key shortcut listener.
*/
#onSearchShortcut = (name, event) => {
if (!this.#isInputOrTextarea(event.target)) {
return;
}
const node = event.originalTarget;
switch (name) {
// replaceAll.key is Alt + find.key
case "replaceAllMac.key":
this.findOrReplace(node, true);
break;
// replaceAll.key is Shift + find.key
case "replaceAll.key":
this.findOrReplace(node, true);
break;
case "find.key":
this.findOrReplace(node, false);
break;
// findPrev.key is Shift + findNext.key
case "findPrev.key":
this.findNextOrPrev(node, true);
break;
case "findNext.key":
this.findNextOrPrev(node, false);
break;
default:
console.error("Unexpected editor key shortcut", name);
return;
}
// Prevent default for this action
event.stopPropagation();
event.preventDefault();
};
/**
* Check if a node is an input or textarea
*/
#isInputOrTextarea(element) {
const name = element.tagName.toLowerCase();
return name === "input" || name === "textarea";
}
/**
* Parse passed code string and returns an HTML string with the same classes CodeMirror
* adds to handle syntax highlighting.
*
* @param {Document} doc: A document that will be used to create elements
* @param {String} code: The code to highlight
* @returns {String} The HTML string for the parsed code
*/
highlightText(doc, code) {
if (!doc) {
return code;
}
const outputNode = doc.createElement("div");
if (!this.config.cm6) {
this.CodeMirror.runMode(code, "application/javascript", outputNode);
} else {
const { codemirrorLangJavascript, lezerHighlight } = this.#CodeMirror6;
const { highlightCode, classHighlighter } = lezerHighlight;
function emit(text, classes) {
const textNode = doc.createTextNode(text);
if (classes) {
const span = doc.createElement("span");
span.appendChild(textNode);
span.className = classes;
outputNode.appendChild(span);
} else {
outputNode.appendChild(textNode);
}
}
function emitBreak() {
outputNode.appendChild(doc.createTextNode("\n"));
}
highlightCode(
code,
codemirrorLangJavascript.javascriptLanguage.parser.parse(code),
classHighlighter,
emit,
emitBreak
);
}
return outputNode.innerHTML;
}
/**
* Focus the CodeMirror editor
*/
focus() {
const cm = editors.get(this);
cm.focus();
}
/**
* Select the whole document
*/
selectAll() {
const cm = editors.get(this);
if (this.config.cm6) {
cm.dispatch({
selection: { anchor: 0, head: cm.state.doc.length },
userEvent: "select",
});
} else {
cm.execCommand("selectAll");
}
}
}
// Since Editor is a thin layer over CodeMirror some methods
// are mapped directly—without any changes.
CM_MAPPING.forEach(name => {
Editor.prototype[name] = function (...args) {
const cm = editors.get(this);
return cm[name].apply(cm, args);
};
});
/**
* We compute the CSS property names, values, and color names to be used with
* CodeMirror to more closely reflect what is supported by the target platform.
* The database is used to replace the values used in CodeMirror while initiating
* an editor object. This is done here instead of the file codemirror/css.js so
* as to leave that file untouched and easily upgradable.
*/
function getCSSKeywords(cssProperties) {
function keySet(array) {
const keys = {};
for (let i = 0; i < array.length; ++i) {
keys[array[i]] = true;
}
return keys;
}
const propertyKeywords = cssProperties.getNames();
const colorKeywords = {};
const valueKeywords = {};
propertyKeywords.forEach(property => {
if (property.includes("color")) {
cssProperties.getValues(property).forEach(value => {
colorKeywords[value] = true;
});
} else {
cssProperties.getValues(property).forEach(value => {
valueKeywords[value] = true;
});
}
});
return {
propertyKeywords: keySet(propertyKeywords),
colorKeywords,
valueKeywords,
};
}
module.exports = Editor;